| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Tetramethylrhodamine manufacturers
- TETRAMETHYLRHODAMINE
-
-
2025-12-24
- CAS:70281-37-7
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 1000 tons
|
| | Tetramethylrhodamine Basic information |
| Product Name: | Tetramethylrhodamine | | Synonyms: | 5-Carboxytetramethylrhodamine-azide;Azide-fluor 545;TAMRA PEG azide.;tetramethylrhodamine chloride;[9-(2-carboxyphenyl)-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium;TAMRA-azide;Tetramethylrhodamine | | CAS: | 70281-37-7 | | MF: | C24H23ClN2O3 | | MW: | 422.9 | | EINECS: | | | Product Categories: | | | Mol File: | 70281-37-7.mol |  |
| | Tetramethylrhodamine Chemical Properties |
| storage temp. | -20°C | | solubility | DMSO, DMF | | form | solid | | Appearance | Dark red amorphous solid | | InChI | InChI=1S/C24H22N2O3.ClH/c1-25(2)15-9-11-19-21(13-15)29-22-14-16(26(3)4)10-12-20(22)23(19)17-7-5-6-8-18(17)24(27)28;/h5-14H,1-4H3;1H | | InChIKey | WGTODYJZXSJIAG-UHFFFAOYSA-N | | SMILES | C1(C2C=CC=CC=2C(=O)O)=C2C=C/C(=[N+](/C)\C)/C=C2OC2C=C(N(C)C)C=CC1=2.[Cl-] |
| | Tetramethylrhodamine Usage And Synthesis |
| Description | The red-fluorescent TAMRA Azide (TAMRA-PEG4-Azide) can be reacted with terminal alkynes via a copper-catalyzed click reaction (CuAAC). It also reacts with strained cyclooctyne via a copper-free “click chemistry” reaction to form a stable triazole and does not require Cu-catalyst or elevated temperatures.TAMRA (tetramethylrhodamine) is a bright fluorescent label is compatible with various excitation sources including mercury arc, tungsten and xenon arc lamps, the 544 nm line of the Helium-Neon laser and the 532 nm green laser line. | | Uses | Can be used to detect or label alkyne- or cyclooctyne-containing molecules or biomolecules by fluorescence spectroscopy following an azide-alkyne click chemistry reaction.
Spectral Properties: Abs/Em = 546/565 nm | | Definition | ChEBI: Tetramethylrhodamine chloride is an organic chloride salt. It has a role as a fluorochrome. It contains a tetramethylrhodamine. | | reaction suitability | reaction type: click chemistry | | Abs/Em Maxima | 553/575 nm | | Extinction Coefficient | 92,000 | | Spectrally Similar Dyes | Alexa Fluor® 546, Atto™ 543, CF® 543 Dye |
| | Tetramethylrhodamine Preparation Products And Raw materials |
|