| Company Name: |
Rhawn Reagent |
| Tel: |
400-400-1332688 18019345275 |
| Email: |
huyue@rhawn.cn |
|
| | 3-(3-Oxo-3,4-dihydro-quinoxalin-2-yl)-propionic acid Basic information |
| | 3-(3-Oxo-3,4-dihydro-quinoxalin-2-yl)-propionic acid Chemical Properties |
| Melting point | 262-262.5 °C | | density | 1.41±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 4.36±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C11H10N2O3/c14-10(15)6-5-9-11(16)13-8-4-2-1-3-7(8)12-9/h1-4H,5-6H2,(H,13,16)(H,14,15) | | InChIKey | HROJWOXFEZYMGL-UHFFFAOYSA-N | | SMILES | [nH]1c2c(nc([c]1=O)CCC(=O)O)cccc2 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-(3-Oxo-3,4-dihydro-quinoxalin-2-yl)-propionic acid Usage And Synthesis |
| | 3-(3-Oxo-3,4-dihydro-quinoxalin-2-yl)-propionic acid Preparation Products And Raw materials |
|