Phenylethyl beta-D-glucopyranoside manufacturers
|
| | Phenylethyl beta-D-glucopyranoside Basic information |
| Product Name: | Phenylethyl beta-D-glucopyranoside | | Synonyms: | b-Phenylethyl b-D-Glucoside;β-Phenylethyl β-D-Glucoside;Phenylethyl-b-D-glucopyranoside;(2R,3S,4S,5R,6R)-2-(Hydroxymethyl)-6-phenethoxytetrahydro-2H-pyran-3,4,5-triol;--Phenylethyl --D-GlucosideQ: What is
--Phenylethyl --D-Glucoside Q: What is the CAS Number of
--Phenylethyl --D-Glucoside Q: What is the storage condition of
--Phenylethyl --D-Glucoside Q: What are the applications of
--Phenylethyl --D-Glucoside;2-Phenylethyl-beta-glucopyranoside;Metoprolol Impurity 37;β-D-Glucopyranoside, 2-phenylethyl | | CAS: | 18997-54-1 | | MF: | C14H20O6 | | MW: | 284.3 | | EINECS: | | | Product Categories: | Aromatics;Carbohydrates & Derivatives;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 18997-54-1.mol |  |
| | Phenylethyl beta-D-glucopyranoside Chemical Properties |
| Melting point | 115 - 117°C | | Boiling point | 486.8±45.0 °C(Predicted) | | density | 1.36±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator, Under Inert Atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | pka | 12.92±0.70(Predicted) | | color | White to Off-White | | Major Application | metabolomics vitamins, nutraceuticals, and natural products | | InChI | InChI=1S/C14H20O6/c15-8-10-11(16)12(17)13(18)14(20-10)19-7-6-9-4-2-1-3-5-9/h1-5,10-18H,6-8H2/t10-,11-,12+,13-,14-/m1/s1 | | InChIKey | MLRIJUWUQTVDQE-RKQHYHRCSA-N | | SMILES | O(CCC1=CC=CC=C1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Phenylethyl beta-D-glucopyranoside Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | One of the two new glycosides from Conyza bonariensis. | | Definition | ChEBI: Phenylethyl beta-D-glucopyranoside is a glycoside. |
| | Phenylethyl beta-D-glucopyranoside Preparation Products And Raw materials |
|