| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 2-Mercaptoethanol-d6 Basic information |
| | 2-Mercaptoethanol-d6 Chemical Properties |
| Boiling point | 157 °C (dec.)(lit.) | | density | 1.204 g/mL at 25 °C | | Fp | 165 °F | | InChI | 1S/C2H6OS/c3-1-2-4/h3-4H,1-2H2/i1D2,2D2,3D/hD | | InChIKey | DGVVWUTYPXICAM-AFCDONKGSA-N | | SMILES | [2H]OC([2H])([2H])C([2H])([2H])S[2H] | | CAS Number Unlabeled | 60-24-2 |
| Hazard Codes | T,N | | Risk Statements | 22-24-34-51/53 | | Safety Statements | 26-36/37/39-45-60 | | RIDADR | UN 2966 6.1/PG 2 | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 4 Oral
Aquatic Chronic 2
Eye Dam. 1
Skin Corr. 1B |
| | 2-Mercaptoethanol-d6 Usage And Synthesis |
| Uses | 2-Mercaptoethanol-d6 is deuterium labeled 2-Mercaptoethanol[1]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019 Feb;53(2):211-216. DOI:10.1177/1060028018797110 |
| | 2-Mercaptoethanol-d6 Preparation Products And Raw materials |
|