|
|
| | tert-Butyl 2-(chlorosulfonyl)ethylcarbamate Basic information |
| Product Name: | tert-Butyl 2-(chlorosulfonyl)ethylcarbamate | | Synonyms: | (2-Chlorosulfonyl-ethyl)-carbaMic acid tert-butyl ester;2-(Boc-amino)ethanesulfonyl Chloride;Carbamic acid, N-[2-(chlorosulfonyl)ethyl]-, 1,1-dimethylethyl ester;tert-Butyl N-[2-(chlorosulfonyl)ethyl]carbamate;N-[2-(Chlorosulfonyl)ethyl]carbamate tert-butyl ester;tert-Butyl 2-(chlorosulfonyl)ethylcarbamate | | CAS: | 134019-73-1 | | MF: | C7H14ClNO4S | | MW: | 243.71 | | EINECS: | | | Product Categories: | | | Mol File: | 134019-73-1.mol |  |
| | tert-Butyl 2-(chlorosulfonyl)ethylcarbamate Chemical Properties |
| Boiling point | 337.4±25.0 °C(Predicted) | | density | 1.290±0.06 g/cm3(Predicted) | | storage temp. | -20°C, stored under nitrogen, away from moisture | | pka | 11.17±0.46(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H14ClNO4S/c1-7(2,3)13-6(10)9-4-5-14(8,11)12/h4-5H2,1-3H3,(H,9,10) | | InChIKey | PCEAZBVTZGTIEC-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NCCS(Cl)(=O)=O |
| | tert-Butyl 2-(chlorosulfonyl)ethylcarbamate Usage And Synthesis |
| | tert-Butyl 2-(chlorosulfonyl)ethylcarbamate Preparation Products And Raw materials |
|