| Company Name: |
RuiKeXin Gold |
| Tel: |
19938953786 |
| Email: |
810766265@qq.com |
|
| | Benzoic acid, 4-amino-3-[[(2S)-2-oxetanylmethyl]amino]-, methyl ester Basic information |
| Product Name: | Benzoic acid, 4-amino-3-[[(2S)-2-oxetanylmethyl]amino]-, methyl ester | | Synonyms: | Benzoic acid, 4-amino-3-[[(2S)-2-oxetanylmethyl]amino]-, methyl ester;methyl (S)-4-amino-3-((oxetan-2-ylmethyl)amino)benzoate;methyl 4-amino-3-[[(2S)-oxetan-2-yl]methylamino]benzoate;Methyl (S)-4-Amino-3-[(2-oxetanylmethyl)amino]benzoate;methyl 4-amino-3-[[(2S)-oxetan-2-yl]methylamino]benzoate - [M85215] | | CAS: | 2230200-74-3 | | MF: | C12H16N2O3 | | MW: | 236.27 | | EINECS: | | | Product Categories: | | | Mol File: | 2230200-74-3.mol | ![Benzoic acid, 4-amino-3-[[(2S)-2-oxetanylmethyl]amino]-, methyl ester Structure](CAS/20210111/GIF/2230200-74-3.gif) |
| | Benzoic acid, 4-amino-3-[[(2S)-2-oxetanylmethyl]amino]-, methyl ester Chemical Properties |
| Boiling point | 453.9±35.0 °C(Predicted) | | density | 1.262±0.06 g/cm3(Predicted) | | pka | 3.60±0.10(Predicted) | | InChI | InChI=1S/C12H16N2O3/c1-16-12(15)8-2-3-10(13)11(6-8)14-7-9-4-5-17-9/h2-3,6,9,14H,4-5,7,13H2,1H3/t9-/m0/s1 | | InChIKey | CEYHKCZODRRMMV-VIFPVBQESA-N | | SMILES | C(OC)(=O)C1=CC=C(N)C(NC[C@@H]2CCO2)=C1 |
| | Benzoic acid, 4-amino-3-[[(2S)-2-oxetanylmethyl]amino]-, methyl ester Usage And Synthesis |
| | Benzoic acid, 4-amino-3-[[(2S)-2-oxetanylmethyl]amino]-, methyl ester Preparation Products And Raw materials |
|