tert-Butyl (4-oxocyclohexyl) methylcarbamate manufacturers
|
| | tert-Butyl (4-oxocyclohexyl) methylcarbamate Basic information |
| Product Name: | tert-Butyl (4-oxocyclohexyl) methylcarbamate | | Synonyms: | 4-N-BOC-AMINOMETHYL-CYCLOHEXONE;Carbamic acid, N-[(4-oxocyclohexyl)methyl]-, 1,1-dimethylethyl ester;tert-butyl (4-Oxo-cyclohexylMethyl)-carbaMte;4-(Aminomethyl)cyclohexanone, N-BOC protected 96%;4-(Aminomethyl)cyclohexanone, N-Boc protected;Tert-butyl N-[(4-oxocyclohexyl)methyl]carbamate;4-(Boc-aminomethyl)cyclohexanone;(4-OXO-CYCLOHEXYLMETHYL)-CARBAMIC ACID TERT-BUTYL ESTER 96% | | CAS: | 809273-70-9 | | MF: | C12H21NO3 | | MW: | 227.3 | | EINECS: | 604-604-1 | | Product Categories: | | | Mol File: | 809273-70-9.mol |  |
| | tert-Butyl (4-oxocyclohexyl) methylcarbamate Chemical Properties |
| Boiling point | 351.5±15.0 °C(Predicted) | | density | 1.038±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 12+-.0.46(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C12H21NO3/c1-12(2,3)16-11(15)13-8-9-4-6-10(14)7-5-9/h9H,4-8H2,1-3H3,(H,13,15) | | InChIKey | KYOXDOGUXCYNAW-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NCC1CCC(=O)CC1 |
| HazardClass | IRRITANT | | HS Code | 2922390090 |
| | tert-Butyl (4-oxocyclohexyl) methylcarbamate Usage And Synthesis |
| Uses | TERT-BUTYL (4-OXOCYCLOHEXYL) METHYLCARBAMATE is used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process. | | Application | Tert-Butyl (4-oxocyclohexyl)methyl) methylcarbamate is used as a reagent in organic synthesis and as a catalyst in the production of polymers and other materials.
| | Hazard | Tert-Butyl (4-oxocyclohexyl)methyl) methylcarbamate can cause skin corrosion/irritation, serious eye damage/eye irritation and specific target organ toxicity.
|
| | tert-Butyl (4-oxocyclohexyl) methylcarbamate Preparation Products And Raw materials |
|