| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (4-Methoxy-phenyl)-dimethyl-amine Basic information |
| Product Name: | (4-Methoxy-phenyl)-dimethyl-amine | | Synonyms: | 4-Amino-N,N-dimethylanisole[4-Methoxy-N,N-dimethylaniline];NSC 86670;p-(Dimethylamino)anisole;p-Methoxy-N,N-dimethylaniline;N,N-dimethyl-4-anisidine;4-N,N-DIMETHYLAMINOANISOLE;N,N-DIMETHYL-PARA-ANISIDINE;4-(Dimethylamino)methoxybenzene | | CAS: | 701-56-4 | | MF: | C9H13NO | | MW: | 151.21 | | EINECS: | | | Product Categories: | | | Mol File: | 701-56-4.mol |  |
| | (4-Methoxy-phenyl)-dimethyl-amine Chemical Properties |
| Melting point | 48 °C | | Boiling point | 237 °C | | density | 0.998±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 5.84±0.12(Predicted) | | Appearance | Off-white to gray Solid | | InChI | InChI=1S/C9H13NO/c1-10(2)8-4-6-9(11-3)7-5-8/h4-7H,1-3H3 | | InChIKey | ZTKDMNHEQMILPE-UHFFFAOYSA-N | | SMILES | C1(N(C)C)=CC=C(OC)C=C1 |
| Risk Statements | 36/37/38 | | HS Code | 29222990 |
| | (4-Methoxy-phenyl)-dimethyl-amine Usage And Synthesis |
| | (4-Methoxy-phenyl)-dimethyl-amine Preparation Products And Raw materials |
|