| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Chemsoon Co., Ltd |
| Tel: |
021-51987688-803 18916626396 |
| Email: |
info@chemsoon.com |
|
| | 2,3,5,6-Tetrafluoroterephthalaldehyde Basic information | | Uses |
| Product Name: | 2,3,5,6-Tetrafluoroterephthalaldehyde | | Synonyms: | Tetrafluoro-p-phthalaldehyde;Tetrafluoroterephthaldehyde;1,4-Benzenedicarboxaldehyde, 2,3,5,6-tetrafluoro-;2,3,5,6-TETRAFLUOROTEREPHTHALALDEHY;2,3,5,6-Tetrafluorotelephtal aldehyde;Tetrafluoroterephtalic aldehyde;2,3,5,6-tetrafluoro-1,4-Benzenedicarboxaldehyde;2,3,5,6-Tetrafluoro-p-dibenzaldehyde | | CAS: | 3217-47-8 | | MF: | C8H2F4O2 | | MW: | 206.09 | | EINECS: | | | Product Categories: | | | Mol File: | 3217-47-8.mol |  |
| | 2,3,5,6-Tetrafluoroterephthalaldehyde Chemical Properties |
| Melting point | 130-132℃ | | Boiling point | 252.6±40.0 °C(Predicted) | | density | 1.590±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C8H2F4O2/c9-5-3(1-13)6(10)8(12)4(2-14)7(5)11/h1-2H | | InChIKey | WJHRAPYKYJKACM-UHFFFAOYSA-N | | SMILES | C1(C=O)=C(F)C(F)=C(C=O)C(F)=C1F |
| | 2,3,5,6-Tetrafluoroterephthalaldehyde Usage And Synthesis |
| Uses | Tetrafluoroterephthaldehyde is useful in the synthesis of highly fluoro-substituted covalent organic frameworks. | | Uses | Tetrafluoroterephthaldehyde is useful in the synthesis of highly fluoro-substituted covalent organic frameworks. |
| | 2,3,5,6-Tetrafluoroterephthalaldehyde Preparation Products And Raw materials |
|