|
|
| | (S)-2-((4-(Trifluoromethyl)phenoxy)methyl)oxirane Basic information |
| Product Name: | (S)-2-((4-(Trifluoromethyl)phenoxy)methyl)oxirane | | Synonyms: | Oxirane, 2-[[4-(trifluoromethyl)phenoxy]methyl]-, (2S)-;(S)?-?4-?(Trifluoromethyl)?-?phenyl Glycidyl Ether;(2S)-2-[[4-(Trifluoromethyl)phenoxy]methyl]oxirane;Seladelpar Impurity 5;2-[[4-(trifluoromethyl)phenoxy]methyl]oxirane;Sevelamer Carbonate Lysine;(S)-2-((4-(Trifluoromethyl)phenoxy)methyl)oxirane | | CAS: | 256372-58-4 | | MF: | C10H9F3O2 | | MW: | 218.17 | | EINECS: | | | Product Categories: | | | Mol File: | 256372-58-4.mol |  |
| | (S)-2-((4-(Trifluoromethyl)phenoxy)methyl)oxirane Chemical Properties |
| Boiling point | 252.5±40.0 °C(Predicted) | | density | 1.304±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C10H9F3O2/c11-10(12,13)7-1-3-8(4-2-7)14-5-9-6-15-9/h1-4,9H,5-6H2/t9-/m1/s1 | | InChIKey | GYOFXQNABVOHIB-SECBINFHSA-N | | SMILES | O1C[C@H]1COC1=CC=C(C(F)(F)F)C=C1 |
| | (S)-2-((4-(Trifluoromethyl)phenoxy)methyl)oxirane Usage And Synthesis |
| Uses | (S)-4-(Trifluoromethyl)-phenyl Glycidyl Ether is a glycidol derivative used in the preparation of organic compounds such as 2-hydroxy-3-phenoxypropylpiperazine derivatives acting as T-type calcium channel blockers. |
| | (S)-2-((4-(Trifluoromethyl)phenoxy)methyl)oxirane Preparation Products And Raw materials |
|