|
|
| | N'-(2-Cyano-4-nitrophenyl)-N,N-dimethyliminoformamide Basic information |
| Product Name: | N'-(2-Cyano-4-nitrophenyl)-N,N-dimethyliminoformamide | | Synonyms: | Methanimidamide, N'-(2-cyano-4-nitrophenyl)-N,N-dimethyl-;N'-(2-cyano-4-nitrophenyl)-N,N-dimethylmethanim idamide;N'-(2-cyano-4-nitrophenyl)-N,N-dimethylformimidamide;-N'-(2-cyano-4-nitrophenyl)-N,N-dimethylformimidamide;Tucatinib internediate;N′-(2-Cyano-4-nitrophenyl)-N,N-dimethyliminoformamide, CAS 39263-34-8;N - (2-cyano-4-nitrophenyl) - N, N-dimethylaminoformamide;(E)-N'-(2-cyano-4-nitrophenyl)-N,N-dimethylformimidamide | | CAS: | 39263-34-8 | | MF: | C10H10N4O2 | | MW: | 218.21 | | EINECS: | | | Product Categories: | | | Mol File: | 39263-34-8.mol |  |
| | N'-(2-Cyano-4-nitrophenyl)-N,N-dimethyliminoformamide Chemical Properties |
| Melting point | 146-148 | | Boiling point | 387.7±52.0 °C(Predicted) | | density | 1.20±0.1 g/cm3(Predicted) | | pka | 4.56±0.50(Predicted) | | InChI | InChI=1S/C10H10N4O2/c1-13(2)7-12-10-4-3-9(14(15)16)5-8(10)6-11/h3-5,7H,1-2H3 | | InChIKey | RLSZPRPVHOOMBN-UHFFFAOYSA-N | | SMILES | C(N(C)C)=NC1=CC=C([N+]([O-])=O)C=C1C#N |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2921490090 |
| | N'-(2-Cyano-4-nitrophenyl)-N,N-dimethyliminoformamide Usage And Synthesis |
| | N'-(2-Cyano-4-nitrophenyl)-N,N-dimethyliminoformamide Preparation Products And Raw materials |
|