| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 3-Aminomethyl-1-N-Boc-piperidine Basic information |
| Product Name: | 3-Aminomethyl-1-N-Boc-piperidine | | Synonyms: | 1-BOC-3-AMINOMETHYLPIPERIDINE;1-PIPERIDINECARBOXYLIC ACID, 3-(AMINOMETHYL)-, 1,1-DIMETHYLETHYL ESTER;(+/-)-1-N-BOC-PIPERIDINE-3-METHYLAMINE;1-N-BOC-3-(AMINOMETHYL)-PIPERIDINE;3-(AMINOMETHYL)-N-BOC-PIPERIDINE;3-(AMINOMETHYL)-1-N-BOC-PIPERIDINE;DL-3-AMINOMETHYL-1-N-BOC-PIPERIDINE;BOC-((R,S)-3-AMINOMETHYL)-PIPERIDINE | | CAS: | 162167-97-7 | | MF: | C11H22N2O2 | | MW: | 214.31 | | EINECS: | | | Product Categories: | Piperidines;pharmacetical;Piperidine;Amines | | Mol File: | 162167-97-7.mol |  |
| | 3-Aminomethyl-1-N-Boc-piperidine Chemical Properties |
| Boiling point | 299.4±13.0 °C(Predicted) | | density | 0.995 g/mL at 25 °C | | refractive index | n20/D1.469 | | Fp | >110℃ | | storage temp. | 2-8°C | | pka | 10.12±0.29(Predicted) | | form | clear liquid | | color | Colorless to Light yellow | | InChI | 1S/C11H22N2O2/c1-11(2,3)15-10(14)13-6-4-5-9(7-12)8-13/h9H,4-8,12H2,1-3H3 | | InChIKey | WPWXYQIMXTUMJB-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)N1CCCC(CN)C1 | | CAS DataBase Reference | 162167-97-7(CAS DataBase Reference) |
| Hazard Codes | Xi,N,Xn | | Risk Statements | 22-36-50/53 | | Safety Statements | 26-60-61 | | RIDADR | UN 3082 9 / PGIII | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29333990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Irrit. 2 |
| | 3-Aminomethyl-1-N-Boc-piperidine Usage And Synthesis |
| Chemical Properties | Pale yellow oil | | Uses | 3-Aminomethyl-1-Boc-piperidine is used as pharmaceutical intermediate. |
| | 3-Aminomethyl-1-N-Boc-piperidine Preparation Products And Raw materials |
|