Aluminium hydroxybis[2,2'-methylen-bis(4,6-di-tert-butylphenyl)phosphate] manufacturers
|
| | Aluminium hydroxybis[2,2'-methylen-bis(4,6-di-tert-butylphenyl)phosphate] Basic information | | Physical Form |
| Product Name: | Aluminium hydroxybis[2,2'-methylen-bis(4,6-di-tert-butylphenyl)phosphate] | | Synonyms: | Bis(2,4,8,10-tetra-tert-butyl-6-hydroxy-12H-dibenzo[d,g][1,3,2]dioxaphosphocin-6-oxide) aluminum hydroxide;aluminium hydroxybis[2,2'-methylen-bis(4,6-di-tert-butylphenyl)phosphate];ALUMINUM HYDROXY BIS[2,2-METHYLENE-BIS(4,6-DI-TERT-BUTYLPHENYL)PHOSPHATE];ALUMINIUMHYDROXYBIS22METHYLENEBIS46DITERTBUTYLPHENYLPHOSPHATE;Bis(2,4,8,10-tetra-tert-butyl-6-hydroxy-12H-dibenzo[d,g][1.3.2]-dioxaphophosyn-6-oxide) aluminum hydroxide;Nucleating Agent N21;Aluminum, hydroxybis[2,4,8,10-tetrakis(1,1-d imethylethyl)-6-(hydroxy-.kappa.O)-12H-d ibenzo[d,g][1,3,2]dioxaphosphocin 6-oxidato]-;Nucleating agent 21 | | CAS: | 151841-65-5 | | MF: | C58H85AlO9P2 | | MW: | 1015.24 | | EINECS: | | | Product Categories: | | | Mol File: | 151841-65-5.mol | ![Aluminium hydroxybis[2,2'-methylen-bis(4,6-di-tert-butylphenyl)phosphate] Structure](CAS/GIF/151841-65-5.gif) |
| | Aluminium hydroxybis[2,2'-methylen-bis(4,6-di-tert-butylphenyl)phosphate] Chemical Properties |
| storage temp. | 2-8°C, stored under nitrogen | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChIKey | IQJARXJKVIARHO-UHFFFAOYSA-K | | SMILES | C(C1C=C(C(C)(C)C)C=C2CC3C=C(C(C)(C)C)C=C(C(C)(C)C)C=3OP(=O)(O[Al](O)OP3(OC4C(=CC(C(C)(C)C)=CC=4CC4=CC(C(C)(C)C)=CC(C(C)(C)C)=C4O3)C(C)(C)C)=O)OC=12)(C)(C)C | | EPA Substance Registry System | Aluminum, hydroxybis[2,4,8,10-tetrakis(1,1-dimethylethyl)-6-(hydroxy-.kappa.O)-12H-dibenzo[d,g][1,3,2]dioxaphosphocin 6-oxidato]- (151841-65-5) |
| | Aluminium hydroxybis[2,2'-methylen-bis(4,6-di-tert-butylphenyl)phosphate] Usage And Synthesis |
| Physical Form | Liquid | | Uses | ADK Stab NA 21E is a nucleating reagent for polymerization. | | Definition |
Nucleating agent NA-21 (Aluminium hydroxybis[2,2'-methylen-bis(4,6-di-tert-butylphenyl)phosphate]) is a third-generation organophosphate nucleating agent for crystalline polymers, which is the most effective and safest PP stiffening and permeability modification additive in the world. It has the characteristics of high rigidity, high heat resistance, high transparency, high hardness, balanced horizontal and vertical shrinkage, etc. Meanwhile, it has a high crystallization rate, which can greatly shorten the molding cycle and improve the production efficiency of products. The recommended addition amount is 0.03-0.1%, which has an obvious stiffening and translucent effect.
|
| | Aluminium hydroxybis[2,2'-methylen-bis(4,6-di-tert-butylphenyl)phosphate] Preparation Products And Raw materials |
|