Halofantrine hydrochloride manufacturers
- Halofantrine hydrochloride
-
- $10.00 / 1KG
-
2025-09-25
- CAS:36167-63-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | Halofantrine hydrochloride Basic information |
| | Halofantrine hydrochloride Chemical Properties |
| Melting point | 93-96°; mp 203-204° | | storage temp. | 2-8°C | | solubility | DMSO: >10mg/mL | | form | solid | | color | white to off-white | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C26H30Cl2F3NO.ClH/c1-3-5-10-32(11-6-4-2)12-9-25(33)23-16-22-21(14-18(27)15-24(22)28)20-13-17(26(29,30)31)7-8-19(20)23;/h7-8,13-16,25,33H,3-6,9-12H2,1-2H3;1H | | InChIKey | WANGFTDWOFGECH-UHFFFAOYSA-N | | SMILES | Cl.CCCCN(CCCC)CCC(O)c1cc2c(Cl)cc(Cl)cc2c3cc(ccc13)C(F)(F)F | | CAS DataBase Reference | 36167-63-2(CAS DataBase Reference) |
| WGK Germany | 3 | | RTECS | SF7790000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | Halofantrine hydrochloride Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | halofantrine, a drug that is effective against chloroquine-resistant malaria and is now being evaluated in Africa. | | Uses | Antimalarial. | | Brand name | Halfan (GlaxoSmithKline). | | Biological Activity | Halofantrine is a blocker of delayed rectifier potassium current via the inhibition of hERG channel. | | IC 50 | Plasmodium |
| | Halofantrine hydrochloride Preparation Products And Raw materials |
|