|
|
| | 4,4'-Azobis(4-cyano-1-pentanol) Basic information |
| | 4,4'-Azobis(4-cyano-1-pentanol) Chemical Properties |
| Melting point | >58°C (subl.) | | Boiling point | 417.4±45.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 14.49±0.10(Predicted) | | color | Yellow to Dark Orange | | InChI | InChI=1S/C12H20N4O2/c1-11(9-13,5-3-7-17)15-16-12(2,10-14)6-4-8-18/h17-18H,3-8H2,1-2H3 | | InChIKey | IWTIJBANDVIHPX-UHFFFAOYSA-N | | SMILES | N(C(C)(CCCO)C#N)=NC(C)(CCCO)C#N |
| | 4,4'-Azobis(4-cyano-1-pentanol) Usage And Synthesis |
| Uses | The hydroxyl-terminated poly(butyl acrylate) (PBA) can be synthesized by degenerative iodine transfer polymerization (DITP) of the n-butyl acrylate (n-BA) using 4,4'-Azobis(4-cyano-1-pentanol) (ACPO) and diiodoxylene (DIX) as initiator and chain transfer agent, respectively, and subsequently substituted reaction of the iodine-terminated PBA with β-mercaptoethanol in alkaline condition[1]. | | References | [1] Chen, X., Zhang, C., Li, W., Chen, L., Wang, W. (2018). Synthesis of Waterborne Polyurethane by the Telechelic α,ω-Di(hydroxy)poly(n-butyl acrylate). Polymers. https://doi.org/10.3390/polym10020219
|
| | 4,4'-Azobis(4-cyano-1-pentanol) Preparation Products And Raw materials |
|