| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | 2-((4-Amino-5-methoxy-2-methylphenyl)sulfonyl)ethyl hydrogen sulfate Basic information |
| Product Name: | 2-((4-Amino-5-methoxy-2-methylphenyl)sulfonyl)ethyl hydrogen sulfate | | Synonyms: | 2-[(4-amino-5-methoxy-o-tolyl)sulphonyl]ethyl hydrogen sulphate;2-(4-amino-2-methoxy-5-methylphenylsulfonyl)ethyl hydrogensulfate;2-[(4-AMINO-5-METHOXY-2-METHYLPHENYL) SULFONYL] HYDROGENSULFATE ESTER;2-[(4-Amino-5-Methoxy-2-Methylphenyl) Sulfonyl]-ethanol hydrogen sulfate ester;VINYLSULPHONEESTEROFPARACRESIDINE;2-[(4-Amino-5-methoxy-2-methylphenyl)sulfonyl]ethanol hydrogen sulfate;2-[(4-Amino-5-methoxy-2-methylphenyl)-sulfonyl]-ethyl hydrogen sulfate;Sulfuric acid hydrogen 2-(4-amino-5-methoxy-2-methylphenylsulfonyl)ethyl ester | | CAS: | 21635-69-8 | | MF: | C10H15NO7S2 | | MW: | 325.36 | | EINECS: | 244-486-4 | | Product Categories: | Intermediates of Dyes and Pigments | | Mol File: | 21635-69-8.mol |  |
| | 2-((4-Amino-5-methoxy-2-methylphenyl)sulfonyl)ethyl hydrogen sulfate Chemical Properties |
| density | 1.512±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | -3.91±0.18(Predicted) | | InChI | InChI=1S/C10H15NO7S2/c1-7-5-8(11)9(17-2)6-10(7)19(12,13)4-3-18-20(14,15)16/h5-6H,3-4,11H2,1-2H3,(H,14,15,16) | | InChIKey | MRILAYPKVVWTRG-UHFFFAOYSA-N | | SMILES | C(OS(O)(=O)=O)CS(C1=CC(OC)=C(N)C=C1C)(=O)=O | | EPA Substance Registry System | Ethanol, 2-[(4-amino-5-methoxy-2-methylphenyl)sulfonyl]-, hydrogen sulfate (ester) (21635-69-8) |
| | 2-((4-Amino-5-methoxy-2-methylphenyl)sulfonyl)ethyl hydrogen sulfate Usage And Synthesis |
| | 2-((4-Amino-5-methoxy-2-methylphenyl)sulfonyl)ethyl hydrogen sulfate Preparation Products And Raw materials |
|