4,7,10,13,16-Pentaoxaheptadecanoic acid, 17-phenyl- manufacturers
- Benzyl-PEG5-acid
-
-
2025-06-07
- CAS:2514948-41-3
- Min. Order: 5g
- Purity: >98.00%
- Supply Ability: 5g
|
| | 4,7,10,13,16-Pentaoxaheptadecanoic acid, 17-phenyl- Basic information |
| Product Name: | 4,7,10,13,16-Pentaoxaheptadecanoic acid, 17-phenyl- | | Synonyms: | 4,7,10,13,16-Pentaoxaheptadecanoic acid, 17-phenyl-;1-Phenyl-2,5,8,11,14-pentaoxaheptadecan-17-oic acid;BnO-(CH2CH2O)4-CH2CH2COOH;BnO-PEG4-CH2CH2COOH/4,7,10,13,16-Pentaoxaheptadecanoic acid, 17-phenyl-;3-[2-[2-[2-(2-benzyloxyethoxy)ethoxy]ethoxy]ethoxy]propanoicacid;1-Phenyl-2,5,8,11,14-pentaoxahexadecane-17-oic acid;OBn-PEG4-Acid | | CAS: | 2514948-41-3 | | MF: | C18H28O7 | | MW: | 356.41 | | EINECS: | | | Product Categories: | | | Mol File: | 2514948-41-3.mol |  |
| | 4,7,10,13,16-Pentaoxaheptadecanoic acid, 17-phenyl- Chemical Properties |
| Boiling point | 490.8±45.0 °C(Predicted) | | density | 1.135±0.06 g/cm3(Predicted) | | storage temp. | Store at 0-8 °C | | pka | 4.28±0.10(Predicted) |
| | 4,7,10,13,16-Pentaoxaheptadecanoic acid, 17-phenyl- Usage And Synthesis |
| Uses | Benzyl-PEG5-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | | Biological Activity | Benzyl-PEG5-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1].
PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. | | IC 50 | PEGs | | References | [1]. An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 |
| | 4,7,10,13,16-Pentaoxaheptadecanoic acid, 17-phenyl- Preparation Products And Raw materials |
|