- Tolonate HDT
-
-
2026-06-30
- CAS:3779-63-3
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kg
- Tolonate HDT
-
- $1.00
-
2024-07-15
- CAS:3779-63-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20t
|
| | (2,4,6-trioxotriazine-1,3,5(2H,4H,6H)-triyl)tris(hexamethylene) isocyanate Basic information |
| Product Name: | (2,4,6-trioxotriazine-1,3,5(2H,4H,6H)-triyl)tris(hexamethylene) isocyanate | | Synonyms: | (2,4,6-trioxotriazine-1,3,5(2H,4H,6H)-triyl)tris(hexamethylene) isocyanate;1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris(6-isocyanatohexyl)-;HEXAMETHYLENEDIISOCYANATEISOCYANURATE;HDIISOCYANURATE;1,6-HEXAMETHYLENEDIISOCYANATEISOCYANURATE;TRISHEXAMETHYLENE TRIISOCYANATE);[(1,2,3,4,5,6-Hexahydro-2,4,6-trioxo-1,3,5-triazine-1,3,5-triyl)trishexamethylene]triisocyanate;1,3,5-Tris(6-isocyanatohexyl)-1,3,5-triazine-2,4,6(1H,3H,5H)-trione | | CAS: | 3779-63-3 | | MF: | C24H36N6O6 | | MW: | 504.58 | | EINECS: | 223-242-0 | | Product Categories: | | | Mol File: | 3779-63-3.mol |  |
| | (2,4,6-trioxotriazine-1,3,5(2H,4H,6H)-triyl)tris(hexamethylene) isocyanate Chemical Properties |
| Melting point | >300 °C | | Boiling point | 648.2±50.0 °C(Predicted) | | density | 1.20±0.1 g/cm3(Predicted) | | vapor pressure | 0.001Pa at 20℃ | | pka | -2.17±0.20(Predicted) | | InChI | InChI=1S/C24H36N6O6/c31-19-25-13-7-1-4-10-16-28-22(34)29(17-11-5-2-8-14-26-20-32)24(36)30(23(28)35)18-12-6-3-9-15-27-21-33/h1-18H2 | | InChIKey | KCZQSKKNAGZQSZ-UHFFFAOYSA-N | | SMILES | N1(CCCCCCN=C=O)C(=O)N(CCCCCCN=C=O)C(=O)N(CCCCCCN=C=O)C1=O | | LogP | 9.81 at 20℃ | | EPA Substance Registry System | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris(6-isocyanatohexyl)- (3779-63-3) |
| | (2,4,6-trioxotriazine-1,3,5(2H,4H,6H)-triyl)tris(hexamethylene) isocyanate Usage And Synthesis |
| Uses | Hexamethylene Diisocyanate Isocyanurate Trimer is used as a building block for non-volatile polycondensation products, such as HDI-isocyanurate (HDI-IC) and HDI-biuret (HDI-BT). | | Definition | ChEBI: A derivative of isocyanuric acid having a 6-isocyanatohexyl group at each of the 1-, 3- and 5-positions. | | Toxics Screening Level | The ITSL for aliphatic polyisocyanate-1 has been changed from 0.04 μg/m3 to 0.1 μg/m3 based on an annual averaging time. |
| | (2,4,6-trioxotriazine-1,3,5(2H,4H,6H)-triyl)tris(hexamethylene) isocyanate Preparation Products And Raw materials |
|