- UV ABSORBER B-CAP
-
- $0.00 / 25KG
-
2024-09-20
- CAS:6337-43-5
- Min. Order: 25KG
- Purity: 99
- Supply Ability: 20
|
| | tetraethyl 2,2'-(1,4-phenylenedimethylidyne)bismalonate Basic information | | Uses |
| Product Name: | tetraethyl 2,2'-(1,4-phenylenedimethylidyne)bismalonate | | Synonyms: | tetraethyl 2,2'-(1,4-phenylenedimethylidyne)bismalonate;[2,2'-(1,4-Phenylene)bis(ethene)]-1,1,1',1'-tetracarboxylic acid tetraethyl ester;α,α'-Bis(ethoxycarbonyl)-1,4-benzenedipropenoic acid diethyl ester;Einecs 228-726-5;Propanedioic acid, 2,2'-(1,4-phenylenedimethylidyne)bis-, 1,1',3,3'-tetraethyl ester;Propanedioic acid, 2,2'-(1,4-phenylenedimethylidyne)bis-, tetraethyl ester;B-CAP;Hostavin B-CAP | | CAS: | 6337-43-5 | | MF: | C22H26O8 | | MW: | 418.44 | | EINECS: | 228-726-5 | | Product Categories: | | | Mol File: | 6337-43-5.mol |  |
| | tetraethyl 2,2'-(1,4-phenylenedimethylidyne)bismalonate Chemical Properties |
| Melting point | 136-137℃ | | Boiling point | 484.4±45.0 °C(Predicted) | | density | 1.195 | | vapor pressure | 0Pa at 25℃ | | Water Solubility | 1mg/L at 22℃ | | InChI | InChI=1S/C22H26O8/c1-5-27-19(23)17(20(24)28-6-2)13-15-9-11-16(12-10-15)14-18(21(25)29-7-3)22(26)30-8-4/h9-14H,5-8H2,1-4H3 | | InChIKey | YUOKTNQLLUHUEK-UHFFFAOYSA-N | | SMILES | C1(/C=C(\C(OCC)=O)/C(OCC)=O)=CC=C(/C=C(/C(OCC)=O)\C(OCC)=O)C=C1 | | LogP | 3.39 at 23℃ | | EPA Substance Registry System | Propanedioic acid, 2,2'-(1,4-phenylenedimethylidyne)bis-, tetraethyl ester (6337-43-5) |
| | tetraethyl 2,2'-(1,4-phenylenedimethylidyne)bismalonate Usage And Synthesis |
| Uses | UV-988 is a high-absorption UV absorber developed specifically for transparent polymer materials. It effectively absorbs the UVB band of ultraviolet light, which is sensitive to PC/PET/PMMA materials, reducing UV damage to the substrate. This allows the material to withstand various weather conditions and maintain good optical and physical properties even after long-term use. Consequently, it extends the lifespan of solar panels and films, achieving the goal of aging resistance. | | Flammability and Explosibility | Non flammable |
| | tetraethyl 2,2'-(1,4-phenylenedimethylidyne)bismalonate Preparation Products And Raw materials |
|