|
|
| | 1-N-Boc-2-(hydroxymethyl)piperazine Basic information |
| Product Name: | 1-N-Boc-2-(hydroxymethyl)piperazine | | Synonyms: | 1-Boc-2-Hydroxymethyl-piperazine;1-N-Boc-2-(hydroxymethyl)piperazine;1-Boc-2-HydroxyMethyl-piperazin;1-Piperazinecarboxylic acid, 2-(hydroxymethyl)-, 1,1-dimethylethyl ester;2-(Hydroxymethyl)piperazine, N1-BOC protected 97%;2-(Hydroxymethyl)piperazine, N1-BOC protected;2-(hydroxymethyl)-1-Piperazinecarboxylic acid tert-butyl ester;tert-Butyl 2-(hydroxyMethyl)piperazine-1-carboxylate | | CAS: | 205434-75-9 | | MF: | C10H20N2O3 | | MW: | 216.28 | | EINECS: | | | Product Categories: | Piperaizine | | Mol File: | 205434-75-9.mol |  |
| | 1-N-Boc-2-(hydroxymethyl)piperazine Chemical Properties |
| Boiling point | 324.0±17.0 °C(Predicted) | | density | 1.085±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 14.97±0.10(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | -0.26° (C=1.00 g/100ml,CHCL3) | | InChI | InChI=1S/C10H20N2O3/c1-10(2,3)15-9(14)12-5-4-11-6-8(12)7-13/h8,11,13H,4-7H2,1-3H3 | | InChIKey | BCPPNDHZUPIXJM-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCNCC1CO |
| | 1-N-Boc-2-(hydroxymethyl)piperazine Usage And Synthesis |
| | 1-N-Boc-2-(hydroxymethyl)piperazine Preparation Products And Raw materials |
|