|
|
| | (R)-N-Boc-piperazine-2-carboxylic acid methyl ester Basic information |
| Product Name: | (R)-N-Boc-piperazine-2-carboxylic acid methyl ester | | Synonyms: | (R)-Piperazine-1,2-dicarboxylic acid 1-tert-butyl ester 2-methyl ester
(R)-1-Boc-piperazine-2-carboxylic acid methyl ester;[(2-N-BOC)PIPERAZINE(2R)COOH]-OME;(R)-PIPERAZINE-1,2-DICARBOXYLIC ACID 1-TERT-BUTYL ESTER 2-METHYL ESTER;(R)-1-N-BOC-PIPERAZINE-2-CARBOXYLIC ACID METHYL ESTER;(R)-1-TERT-BUTYL 2-METHYL PIPERAZINE-1,2-DICARBOXYLATE;(R)-N-Boc-piperazine-2-carboxylic acid methyl ester;(R)-1--Boc-Piperazine-2-carboxylic acid methyl ester;Methyl (R)-1-Boc-piperazine-2-carboxylate | | CAS: | 252990-05-9 | | MF: | C11H20N2O4 | | MW: | 244.29 | | EINECS: | | | Product Categories: | amino acids;pharmacetical;Piperaizine | | Mol File: | 252990-05-9.mol |  |
| | (R)-N-Boc-piperazine-2-carboxylic acid methyl ester Chemical Properties |
| Boiling point | 321.3±37.0 °C(Predicted) | | density | 1.118±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 7.25±0.40(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C11H20N2O4/c1-11(2,3)17-10(15)13-6-5-12-7-8(13)9(14)16-4/h8,12H,5-7H2,1-4H3/t8-/m1/s1 | | InChIKey | BRXKHIPPSTYCKO-MRVPVSSYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCNC[C@@H]1C(OC)=O | | CAS DataBase Reference | 252990-05-9(CAS DataBase Reference) |
| | (R)-N-Boc-piperazine-2-carboxylic acid methyl ester Usage And Synthesis |
| Synthesis | Trimethylsilylated diazomethane (2 M solution in hexane, 14 mL) was slowly added dropwise to a mixture of (R)-N-Boc-2-piperazinecarboxylic acid (5 g) dissolved in methanol (100 mL) and dichloromethane (115 mL). The reaction mixture was stirred at room temperature for 16 hours. Upon completion of the reaction, the solvent was removed by distillation under reduced pressure and the residue obtained was purified by column chromatography, first using ethyl acetate as eluent and subsequently using a solution of ethyl acetate containing 5% methanol and 7N ammonia as eluent to afford methyl (R)-1-Boc-2-piperazinecarboxylate as an oil (2.55 g, 48% yield). NMR hydrogen spectrum (DMSO-d6) δ 1.40 (s, 9H), 2.10 (bs, 1H), 2.52 (m, 1H), 2.72 (dd, 1H), 2.82 (d, 1H), 2.97 (m, 1H), 3.29 (d, 1H), 3.61 (d, 1H), 3.67 (s, 3H), 4.43 (m, 1H); mass spectrum showed the molecular ion peak MH+ 245. | | References | [1] Patent: WO2005/26152, 2005, A1. Location in patent: Page/Page column 136 |
| | (R)-N-Boc-piperazine-2-carboxylic acid methyl ester Preparation Products And Raw materials |
|