|
|
| | 2-Bromofuran-4-carboxylic acid Basic information |
| | 2-Bromofuran-4-carboxylic acid Chemical Properties |
| Melting point | 130 °C | | Boiling point | 279.4±25.0 °C(Predicted) | | density | 1.891±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, sealed storage, away from moisture | | form | powder | | pka | 3.73±0.25(Predicted) | | color | White | | InChI | InChI=1S/C5H3BrO3/c6-4-1-3(2-9-4)5(7)8/h1-2H,(H,7,8) | | InChIKey | XYBPFWUNJQTZCM-UHFFFAOYSA-N | | SMILES | O1C(Br)=CC(C(O)=O)=C1 |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 2932190090 |
| | 2-Bromofuran-4-carboxylic acid Usage And Synthesis |
| | 2-Bromofuran-4-carboxylic acid Preparation Products And Raw materials |
|