|
|
| | 4-(Trifluoromethyl)-1-indanone Basic information |
| Product Name: | 4-(Trifluoromethyl)-1-indanone | | Synonyms: | 1H-Inden-1-one, 2,3-dihydro-4-(trifluoroMethyl)-;2,3-Dihydro-4-(trifluoromethyl)-1H-inden-1-one, 2,3-Dihydro-1-oxo-4-(trifluoromethyl)-1H-indene;4-(Trifluoromethyl)-1-indanone 97%;4-(Trifluoromethyl)-1-indanone;4-(trifluoroMethyl)-2,3-dihydro-1H-inden-1-one;4-TrifluoroMethyl-indan-1-one;4-(Trifluoromethyl)-2,3-dihydro-1-indenone;4-(trifluoromethyl)-2,3-dihydroinden-1-one | | CAS: | 68755-42-0 | | MF: | C10H7F3O | | MW: | 200.16 | | EINECS: | | | Product Categories: | C9;Carbonyl Compounds;Ketones | | Mol File: | 68755-42-0.mol |  |
| | 4-(Trifluoromethyl)-1-indanone Chemical Properties |
| Melting point | 38-42 °C | | Boiling point | 67-72/0.1 mmHg | | density | 1.347±0.06 g/cm3(Predicted) | | Fp | 108 °C | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | color | White | | InChI | 1S/C10H7F3O/c11-10(12,13)8-3-1-2-7-6(8)4-5-9(7)14/h1-3H,4-5H2 | | InChIKey | LJVBFMQEZSEGRL-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1cccc2C(=O)CCc12 |
| Hazard Codes | Xn | | Risk Statements | 22-43 | | Safety Statements | 36/37 | | WGK Germany | 3 | | HS Code | 2914390090 | | Storage Class | 12 - Non Combustible Liquids | | Hazard Classifications | Acute Tox. 4 Oral
Skin Sens. 1 |
| | 4-(Trifluoromethyl)-1-indanone Usage And Synthesis |
| Uses | 4-(Trifluoromethyl)-1-indanone is a ketone organic compound used in organic synthesis.
|
| | 4-(Trifluoromethyl)-1-indanone Preparation Products And Raw materials |
|