| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-Boc-1-(6-methyl-2-pyridyl)piperazine Basic information |
| | 4-Boc-1-(6-methyl-2-pyridyl)piperazine Chemical Properties |
| Melting point | 80-84 °C (lit.) | | Boiling point | 409.3±45.0 °C(Predicted) | | density | 1.111±0.06 g/cm3(Predicted) | | pka | 9.14±0.19(Predicted) | | form | Powder | | color | White to off-white | | InChI | 1S/C15H23N3O2/c1-12-6-5-7-13(16-12)17-8-10-18(11-9-17)14(19)20-15(2,3)4/h5-7H,8-11H2,1-4H3 | | InChIKey | QEDVZUFNZJJSJL-UHFFFAOYSA-N | | SMILES | Cc1cccc(n1)N2CCN(CC2)C(=O)OC(C)(C)C |
| Hazard Codes | T | | Risk Statements | 25-36/37/38 | | Safety Statements | 26-36/37-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | 6.1 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Boc-1-(6-methyl-2-pyridyl)piperazine Usage And Synthesis |
| | 4-Boc-1-(6-methyl-2-pyridyl)piperazine Preparation Products And Raw materials |
|