CX546 (1-(1,4-benzodioxan-6-ylcarbonyl)p manufacturers
- CX546
-
- $34.00
-
2026-07-14
- CAS:215923-54-9
- Purity: 99.75%
- Supply Ability: 10g
|
| | CX546 (1-(1,4-benzodioxan-6-ylcarbonyl)p Basic information |
| Product Name: | CX546 (1-(1,4-benzodioxan-6-ylcarbonyl)p | | Synonyms: | 1-(2,3-Dihydro-1,4-benzodioxin-6-ylcarbonyl)piperidine;1-(1,4-Benzodioxan-6-ylcarbonyl)piperidine;CX-546;BDP-17,CX546,GR87;Methanone,(2,3-dihydro-1,4-benzodioxin-6-yl)-1-piperidinyl-;(2,3-dihydrobenzo[b][1,4]dioxin-6-yl)(piperidin-1-yl)Methanone;(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-piperidinylmethanone;BDP 17 | | CAS: | 215923-54-9 | | MF: | C14H17NO3 | | MW: | 247.29 | | EINECS: | | | Product Categories: | Aromatics;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals;AMPA receptor potentiator which is specifically bound to agonist bound non-desensitized receptors. | | Mol File: | 215923-54-9.mol |  |
| | CX546 (1-(1,4-benzodioxan-6-ylcarbonyl)p Chemical Properties |
| Melting point | 71-73°C | | Boiling point | 422.8±44.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: ≥10mg/mL | | pka | -1.08±0.20(Predicted) | | form | solid | | color | white to off-white | | InChI | 1S/C14H17NO3/c16-14(15-6-2-1-3-7-15)11-4-5-12-13(10-11)18-9-8-17-12/h4-5,10H,1-3,6-9H2 | | InChIKey | LJUNPHMOGNFFOS-UHFFFAOYSA-N | | SMILES | O=C(N1CCCCC1)c2ccc3OCCOc3c2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | CX546 (1-(1,4-benzodioxan-6-ylcarbonyl)p Usage And Synthesis |
| Uses | It is one of a series of AMPA modulators
matergic AMPA receptors. | | Uses | CX546 has been used as positive allosteric modulator for the glutamatergic receptor α-amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid (AMPA) in mice. | | General Description | CX546, a benzoylpiperidine derivative ampakine is an analog of CX516. | | Biological Activity | AMPA receptor potentiator. Binds specifically to the agonist bound non-desensitized receptor, most likely destabilizing the desensitized receptor conformation. Enhances cognitive function in rats. | | Biochem/physiol Actions | CX546 has antipsychotic functionality and has the potential to treat schizophrenia. It improves the defects associated with the prepulse inhibition (PPI) and latent inhibition (LI)in mice lacking metabotropic glutamate receptor type 5 (mGluR5). Additionally, CX546 potentiates synaptic plasticity, elicits neuroprotection and promotes the neurotrophin expression. | | storage | Store at +4°C |
| | CX546 (1-(1,4-benzodioxan-6-ylcarbonyl)p Preparation Products And Raw materials |
|