| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2-(5-Phenyl-2-oxazolyl)benzoic acid Basic information |
| | 2-(5-Phenyl-2-oxazolyl)benzoic acid Chemical Properties |
| Melting point | 195-199 °C | | Boiling point | 494.5±47.0 °C(Predicted) | | density | 1.271±0.06 g/cm3(Predicted) | | pka | 3.45±0.36(Predicted) | | form | solid | | InChI | 1S/C16H11NO3/c18-16(19)13-9-5-4-8-12(13)15-17-10-14(20-15)11-6-2-1-3-7-11/h1-10H,(H,18,19) | | InChIKey | HEIBWPHLFHWDAX-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccccc1-c2ncc(o2)-c3ccccc3 |
| Hazard Codes | Xi | | Risk Statements | 37/38-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 2-(5-Phenyl-2-oxazolyl)benzoic acid Usage And Synthesis |
| | 2-(5-Phenyl-2-oxazolyl)benzoic acid Preparation Products And Raw materials |
|