| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3-Bromo-2-(4'-chlorobenzyloxy)-5-methyl& Basic information |
| | 3-Bromo-2-(4'-chlorobenzyloxy)-5-methyl& Chemical Properties |
| Melting point | 120-125 °C(lit.) | | Boiling point | 514.5±60.0 °C(Predicted) | | density | 1.54±0.1 g/cm3(Predicted) | | pka | 7.65±0.53(Predicted) | | form | solid | | InChI | 1S/C14H13BBrClO3/c1-9-6-12(15(18)19)14(13(16)7-9)20-8-10-2-4-11(17)5-3-10/h2-7,18-19H,8H2,1H3 | | InChIKey | DKUPKFVGBUWCOP-UHFFFAOYSA-N | | SMILES | Cc1cc(Br)c(OCc2ccc(Cl)cc2)c(c1)B(O)O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Bromo-2-(4'-chlorobenzyloxy)-5-methyl& Usage And Synthesis |
| | 3-Bromo-2-(4'-chlorobenzyloxy)-5-methyl& Preparation Products And Raw materials |
|