| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | N-Isopropylidene-N'-2-nitrobenzenesulfo& Basic information |
| Product Name: | N-Isopropylidene-N'-2-nitrobenzenesulfo& | | Synonyms: | 2-NITRO-N'-(PROPAN-2-YLIDENE)BENZENESULFONOHYDRAZIDE;IPNBSH, Isopropylidenehydrazide o-nitro-benzenesulfonic acid;N'-Isopropylidene-2-nitrobenzenesulfonohydrazide;N-Isopropylidene-N-2-Nitrobenzenesulfonohydrazide;2-(1-Methylethylidene)hydrazide-2-nitrobenzenesulfonic acid;Acetone 2-nitrobenzenesulfonylhydrazone;N-Isopropylidene-Nμ-2-nitrobenzenesulfonyl hydrazine;N-Isopropylidene-N | | CAS: | 6655-27-2 | | MF: | C9H11N3O4S | | MW: | 257.27 | | EINECS: | | | Product Categories: | | | Mol File: | 6655-27-2.mol |  |
| | N-Isopropylidene-N'-2-nitrobenzenesulfo& Chemical Properties |
| Melting point | 131-135 °C | | Boiling point | 421.3±47.0 °C(Predicted) | | density | 1.41±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | 9.11±0.40(Predicted) | | form | powder to crystal | | color | Light yellow to Yellow to Orange | | InChI | 1S/C9H11N3O4S/c1-7(2)10-11-17(15,16)9-6-4-3-5-8(9)12(13)14/h3-6,11H,1-2H3 | | InChIKey | SBNYNTYNEJTMQO-UHFFFAOYSA-N | | SMILES | C\C(C)=N\NS(=O)(=O)c1ccccc1[N+]([O-])=O |
| WGK Germany | 3 | | HS Code | 29350090 | | Storage Class | 11 - Combustible Solids |
| | N-Isopropylidene-N'-2-nitrobenzenesulfo& Usage And Synthesis |
| Uses | IPNBSH A Reagent for the Simple Reduction of Alcohols
Reactant for synthesis of:
- (-)-Acylfulvene and (-)-irofulven for use as antitumor agents
- Bicycloundecadienones and bicyclodecadienones via carbonylative cycloaddition
- Monoalkyldiazenes for allylic reduction
Reacts with di-Me phosphonate | | reaction suitability | reagent type: reductant |
| | N-Isopropylidene-N'-2-nitrobenzenesulfo& Preparation Products And Raw materials |
|