| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | BENZAMIL HYDROCHLORIDE Basic information |
| Product Name: | BENZAMIL HYDROCHLORIDE | | Synonyms: | Benzamil hydrate hydrochloride;N-(Benzylamidino)-3,5-diamino-6-chloropyrazinecarboxamide hydrate hydrochloride;N-(Benzylamidino)-3,5-diamino-6-chloropyrazinecarboxamide hydrochloride hydrate;Benzamil hydrochloride hydrate;3,5-diamino-N-(N'-benzylcarbamimidoyl)-6-chloropyrazine-2-carboxamide,hydrochloride;3;5-DIAMINO-6-CHLORO-N-[IMINO[(PHENYLMETHYL)AMINO]METHYL]-2-PYRAZINECARBOXAMIDE; MONOHYDROCHLORIDE;5-diamino-6-chloro-N-[imino[(phenylmethyl)amino]methyl]-2-pyrazinecarboxamide;N-(Benzylamidino)-3,5-diamino-6-chloropyrazinecarboxamide hydrochloride | | CAS: | 161804-20-2 | | MF: | C13H15Cl2N7O | | MW: | 356.21 | | EINECS: | | | Product Categories: | | | Mol File: | 161804-20-2.mol |  |
| | BENZAMIL HYDROCHLORIDE Chemical Properties |
| storage temp. | 2-8°C | | solubility | methanol: soluble10mg/mL | | form | solid | | color | yellow | | Stability: | Stable for 2 years from date of purchase as supplied. Solutions in DMSO or may be stored at -20°C for up to 3 months. | | InChI | 1S/C13H14ClN7O.ClH.H2O/c14-9-11(16)20-10(15)8(19-9)12(22)21-13(17)18-6-7-4-2-1-3-5-7;;/h1-5H,6H2,(H4,15,16,20)(H3,17,18,21,22);1H;1H2 | | InChIKey | YAJQRPFIYXRNKS-UHFFFAOYSA-N | | SMILES | O.Cl.Nc1nc(N)c(nc1Cl)C(=O)NC(=N)NCc2ccccc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | BENZAMIL HYDROCHLORIDE Usage And Synthesis |
| Description | Benzamil (161804-21-2) is a more potent (Ki = 10 nM vs 182 nM1, IC50 = 9 μM2) version of the epithelial sodium channel blocker Amiloride. It is also an inhibitor of Na+/Ca2+ exchange transport (IC50 = 11 μM)2 and the Na+/H+ antiporter (IC50 = 80 nM)2. | | Uses | Benzamil Hydrochloride is a specific blocker of sodium channels. It also inhibits epithelial sodium channel (ENaC). Benzamil Hydrochloride is an analog of Amiloride (A578700). | | Biochem/physiol Actions | Selective and potent blocker of Na+/H+ and Na+/Ca2+ channels | | storage | Store at +4°C | | References | [1] A. W. CUTHBERT G. M F. EFFECTS OF SOME PYRAZINECARBOXAMIDES ON SODIUM TRANSPORT IN FROG SKIN[J]. British Journal of Pharmacology, 1978, 63 1: 139-149. DOI:10.1111/j.1476-5381.1978.tb07783.x
[2] T R KLEYMAN E J C. Amiloride and its analogs as tools in the study of ion transport.[J]. Journal of Membrane Biology, 1988, 105 1: 1-21. DOI:10.1007/bf01871102 |
| | BENZAMIL HYDROCHLORIDE Preparation Products And Raw materials |
|