| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | O-(2-(Boc-amino)-ethyl)-O-(2-(diglycolyl-amino)ethyl)EG6 Basic information |
| | O-(2-(Boc-amino)-ethyl)-O-(2-(diglycolyl-amino)ethyl)EG6 Chemical Properties |
| Boiling point | 720.2±60.0 °C(Predicted) | | density | 1.157±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.22±0.10(Predicted) | | form | oil | | InChI | 1S/C25H48N2O13/c1-25(2,3)40-24(32)26-4-6-33-8-10-35-12-14-37-16-18-39-19-17-38-15-13-36-11-9-34-7-5-27(22(30)20-28)23(31)21-29/h28-29H,4-21H2,1-3H3,(H,26,32) | | InChIKey | BAMLLPMHTABXAW-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCOCCNC(=O)COCC(O)=O |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids |
| | O-(2-(Boc-amino)-ethyl)-O-(2-(diglycolyl-amino)ethyl)EG6 Usage And Synthesis |
| Chemical Properties | Off-white to yellow oil | | Uses | Boc-NH-(PEG)6-COOH (30 atoms) Novabiochem(R). CAS 600141-83-1, molar mass 584.65 g/mol. | | reaction suitability | reagent type: cross-linking reagent |
| | O-(2-(Boc-amino)-ethyl)-O-(2-(diglycolyl-amino)ethyl)EG6 Preparation Products And Raw materials |
|