| Company Name: |
LGM Pharma |
| Tel: |
1-(800)-881-8210 |
| Email: |
inquiries@lgmpharma.com |
- Imidapril HCl
-
-
2026-06-30
- CAS:89396-94-1
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 5KG
|
| | (S)-3-[(S)-2-((S)-1-Ethoxycarbonyl-3-phenyl-propylamino)-propionyl]-1-methyl-2-oxo-imidazolidine-4-carboxylic acid Basic information |
| | (S)-3-[(S)-2-((S)-1-Ethoxycarbonyl-3-phenyl-propylamino)-propionyl]-1-methyl-2-oxo-imidazolidine-4-carboxylic acid Chemical Properties |
| Melting point | 214-216℃ | | alpha | D20 -64.1° (c = 0.5 in ethanol) | | storage temp. | -20°C | | solubility | H2O: ≥5mg/mL | | form | powder | | color | white to tan | | Optical Rotation | [α]/D -50 to -70° in ethanol (c=0.5) | | Water Solubility | H2O: ≥5mg/mL | | Merck | 14,4911 | | InChIKey | KLZWOWYOHUKJIG-GJECGLBRNA-N | | SMILES | C1(=O)N(C)C[C@@H](C(O)=O)N1C([C@@H](N[C@H](C(OCC)=O)CCC1=CC=CC=C1)C)=O |&1:5,11,13,r| |
| WGK Germany | 3 | | RTECS | NI8927400 | | HS Code | 2933.29.4300 |
| | (S)-3-[(S)-2-((S)-1-Ethoxycarbonyl-3-phenyl-propylamino)-propionyl]-1-methyl-2-oxo-imidazolidine-4-carboxylic acid Usage And Synthesis |
| Uses | antibiotic | | Uses | Angiotensin converting enzyme (ACE) inhibitor. Antihypertensive. | | Uses | Imidapril hydrochloride was used as a standard in bioequivalence test by LC/MS method. | | Definition | ChEBI: Imidapril hydrochloride is a dipeptide. | | General Description | Imidapril comprises large acyl moiety and is hydrolyzed by carboxylesterase (CES) 1. | | Biochem/physiol Actions | Imidapril is a potent angiotensin converting enzyme inhibitor and anti-hypertensive. | | Clinical Use | Angiotensin-converting enzyme inhibitor:
Hypertension | | Drug interactions | Potentially hazardous interactions with other drugs
Anaesthetics: enhanced hypotensive effect.
Analgesics: antagonism of hypotensive effect and
increased risk of renal impairment with NSAIDs;
hyperkalaemia with ketorolac and other NSAIDs.
Antihypertensives: increased risk of hyperkalaemia,
hypotension and renal failure with ARBs and
aliskiren.
Bee venom extract: possible severe anaphylactoid
reactions when used together.
Ciclosporin: increased risk of hyperkalaemia and
nephrotoxicity.
Cytotoxics: increased risk of angioedema with
everolimus.
Diuretics: enhanced hypotensive effect;
hyperkalaemia with potassium-sparing diuretics.
ESAs: increased risk of hyperkalaemia; antagonism
of hypotensive effect.
Gold: flushing and hypotension with sodium
aurothiomalate.
Lithium: reduced excretion, possibility of enhanced
lithium toxicity.
Potassium salts: increased risk of hyperkalaemia.
Tacrolimus: increased risk of hyperkalaemia and
nephrotoxicity. | | Metabolism | Imidapril is a prodrug, and is metabolised in the liver
to the diacid imidaprilat, its active metabolite. The
bioavailability of imidaprilat is about 42% after oral doses
of imidapril.
About 40% of an oral dose is excreted in the urine, the
rest in the faeces. |
| | (S)-3-[(S)-2-((S)-1-Ethoxycarbonyl-3-phenyl-propylamino)-propionyl]-1-methyl-2-oxo-imidazolidine-4-carboxylic acid Preparation Products And Raw materials |
|