| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1,2,4-Trichlorobenzene (d3) Basic information |
| Product Name: | 1,2,4-Trichlorobenzene (d3) | | Synonyms: | 1,2,4-TRICHLOROBENZENE-D3, 98 ATOM % D;Deuterated 1,2,4-trichlorobenzene;unsym-Trichlorobenzene-d3;1,2,4-Trichlorobenzene-d?;1,2,4-Trichlorobenzene-d3 in isooctane;1,2,4-Trichlorobenzene-d3;1,2,4-Trichlorobenzene (D?, 98%);1,2,4-Trichlorobenzene (d3) | | CAS: | 2199-72-6 | | MF: | C6Cl3D3 | | MW: | 184.47 | | EINECS: | | | Product Categories: | Alphabetical Listings;Stable Isotopes | | Mol File: | 2199-72-6.mol |  |
| | 1,2,4-Trichlorobenzene (d3) Chemical Properties |
| Melting point | 16 °C (lit.) | | Boiling point | 214 °C (lit.) | | density | 1.454 g/mL | | refractive index | n20/D 1.571(lit.) | | Fp | >230 °F | | solubility | Acetone (Slightly), Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | Henry's Law Constant | 9.8×10-3 mol/(m3Pa) at 25℃, Hiatt (2013) | | InChI | 1S/C6H3Cl3/c7-4-1-2-5(8)6(9)3-4/h1-3H/i1D,2D,3D | | InChIKey | PBKONEOXTCPAFI-CBYSEHNBSA-N | | SMILES | [2H]c1c([2H])c(Cl)c(Cl)c([2H])c1Cl | | EPA Substance Registry System | 1,2,4-Trichlorobenzene-d3 (2199-72-6) |
| Hazard Codes | Xn,N | | Risk Statements | 20/21/22-36/37/38-52/53-50/53-38-22 | | Safety Statements | 26-36-61-60-37/39-23 | | RIDADR | UN 2321 6.1/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Irrit. 2 |
| | 1,2,4-Trichlorobenzene (d3) Usage And Synthesis |
| | 1,2,4-Trichlorobenzene (d3) Preparation Products And Raw materials |
|