- Dihydrogalanthamine
-
- $0.00 / 1kg
-
2025-06-13
- CAS:21133-52-8
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000 kg
- Lycoramine
-
- $9.80 / 1KG
-
2020-02-11
- CAS:21133-52-8
- Min. Order: 1g
- Purity: >98%
- Supply Ability: 20 tons
|
| | Dihydrogalanthamine Basic information |
| Product Name: | Dihydrogalanthamine | | Synonyms: | Dihydrogalanthamine;6H-Benzofuro[3a,3,2-ef][2]benzazepin-6-ol, 4a,5,7,8,9,10,11,12-octahydro-3-methoxy-11-methyl-,(4aS,6S,8aR)-;Galanthamine, 1,2-dihydro-;Galanthamine, dihydro-;(4aS,8aS)-3-Methoxy-11-methyl-4aα,5,7,8,9,10,11,12-octahydro-6H-benzofuro[3a,3,2-ef][2]benzoazepine-6β-ol;(4aS,8aS)-4a,5,7,8,9,10,11,12-Octahydro-3-methoxy-11-methyl-6H-benzofuro[3a,3,2-ef][2]benzazepin-6β-ol;(8aS)-3-Methoxy-5,6,7,8,9,10,11,12-octahydro-11-methyl-4aαH-benzofuro[3a,3,2-ef][2]benzazepine-6β-ol;(4aS,6S,8aS)-4a,5,7,8,9,10,11,12-Octahydro-3-methoxy-11-methyl-6H-benzofuro[3a,3,2-ef][2]benzazepin-6-ol | | CAS: | 21133-52-8 | | MF: | C17H23NO3 | | MW: | 289.37 | | EINECS: | | | Product Categories: | Chiral Reagents;Heterocycles;Inhibitor;Intermediates & Fine Chemicals;Pharmaceuticals;Alkaloids | | Mol File: | 21133-52-8.mol |  |
| | Dihydrogalanthamine Chemical Properties |
| Melting point | 122-124 ºC | | alpha | D27 -98° (alcohol) | | Boiling point | 436.4±45.0 °C(Predicted) | | density | 1.25 | | storage temp. | 4°C, protect from light | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 14.77±0.20(Predicted) | | color | White to Pale Yellow | | InChI | InChI=1S/C17H23NO3/c1-18-8-7-17-6-5-12(19)9-14(17)21-16-13(20-2)4-3-11(10-18)15(16)17/h3-4,12,14,19H,5-10H2,1-2H3/t12-,14-,17-/m0/s1 | | InChIKey | GJRMHIXYLGOZSE-JDFRZJQESA-N | | SMILES | N1(C)CC2=CC=C(OC)C3O[C@]4([H])[C@@](CC[C@H](O)C4)(C2=3)CC1 |
| | Dihydrogalanthamine Usage And Synthesis |
| Uses | One of the minor alkaloids of Lycoris radiata, a highly efficient, selective and sensitive acetylcholinesterase inhibitor. An analog of Galanthamine (G188500). | | Definition | ChEBI: Lycoramine is a benzazepine. |
| | Dihydrogalanthamine Preparation Products And Raw materials |
|