|
|
| | Phosphonic acid, P-[4-(3,6-dimethyl-9H-carbazol-9-yl)butyl]- Basic information |
| Product Name: | Phosphonic acid, P-[4-(3,6-dimethyl-9H-carbazol-9-yl)butyl]- | | Synonyms: | INNYA-2271804;[4-(3,6-dimethyl-9-hydro-carbazole-9-yl)butyl]phosphonic acid;4-(3,6-dimethyl-9-hydrogen-carbazol-9-yl)butyl]phosphonic acid;Me-4PAC;Phosphonic acid, P-[4-(3,6-dimethyl-9H-carbazol-9-yl)butyl]-;Me-4PACz, [4-(3,6-Dimethyl-9H-carbazol-9-yl)butyl]phosphonic Acid;4-(3,6-Dimethyl-9H-carbazol-9-yl)butyl]phosphonicAcid,≥99%;(4- (3,6-dimethyl-9H-carbazole-9-yl) butyl) phosphonic acid | | CAS: | 2747959-96-0 | | MF: | C18H22NO3P | | MW: | 331.35 | | EINECS: | | | Product Categories: | | | Mol File: | 2747959-96-0.mol | ![Phosphonic acid, P-[4-(3,6-dimethyl-9H-carbazol-9-yl)butyl]- Structure](CAS/20211123/GIF/2747959-96-0.gif) |
| | Phosphonic acid, P-[4-(3,6-dimethyl-9H-carbazol-9-yl)butyl]- Chemical Properties |
| Boiling point | 525.8±60.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | pka | 2.61±0.10(Predicted) | | form | solid | | InChI | InChI=1S/C18H22NO3P/c1-13-5-7-17-15(11-13)16-12-14(2)6-8-18(16)19(17)9-3-4-10-23(20,21)22/h5-8,11-12H,3-4,9-10H2,1-2H3,(H2,20,21,22) | | InChIKey | ZNLXWYZMMYDGCE-UHFFFAOYSA-N | | SMILES | C(N1C2=CC=C(C)C=C2C2=CC(C)=CC=C12)CCCP(O)(O)=O |
| | Phosphonic acid, P-[4-(3,6-dimethyl-9H-carbazol-9-yl)butyl]- Usage And Synthesis |
| Uses | Me-4PACz (4-Methyl-4-phenyl-1,3-diazole) is a small molecule that has been explored for various applications, particularly in the field of organic electronics. Notably used in monolithic metal-halide perovskite-silicon tandem solar cells, it has achieved a remarkable PCE of 29.15%, showcasing its effectiveness in advanced applications. |
| | Phosphonic acid, P-[4-(3,6-dimethyl-9H-carbazol-9-yl)butyl]- Preparation Products And Raw materials |
|