5-Acetylthiophene-2-carboxamide manufacturers
|
| | 5-Acetylthiophene-2-carboxamide Basic information |
| Product Name: | 5-Acetylthiophene-2-carboxamide | | Synonyms: | 2-THIOPHENECARBOXAMIDE, 5-ACETYL;5-Acetyl-thiophene-2-carboxylic acid amide;Arotinolol impurity 1;5-Acetylthiophene-2-carboxamide (Arotinolol Impurity);Ripretinib Impurity 25;5-Acetylthiophene-2-carboxamide(Arotinolol Impurity 7);Arolol impurity 4;5-Acetyl-2-thiophenecarboxamide | | CAS: | 68257-89-6 | | MF: | C7H7NO2S | | MW: | 169.2 | | EINECS: | | | Product Categories: | | | Mol File: | 68257-89-6.mol |  |
| | 5-Acetylthiophene-2-carboxamide Chemical Properties |
| Boiling point | 359.3±27.0 °C(Predicted) | | density | 1.310±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 15.21±0.50(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C7H7NO2S/c1-4(9)5-2-3-6(11-5)7(8)10/h2-3H,1H3,(H2,8,10) | | InChIKey | JFVJHFSCKAFLGD-UHFFFAOYSA-N | | SMILES | C1(C(N)=O)SC(C(C)=O)=CC=1 |
| | 5-Acetylthiophene-2-carboxamide Usage And Synthesis |
| Uses | 5-Acetylthiophene-2-carboxamide acts as a reagent for the synthesis and β- adrenergic blocking action of a new thiazolythiopropanolamine. |
| | 5-Acetylthiophene-2-carboxamide Preparation Products And Raw materials |
|