| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,6-Bis(trifluoromethyl)benzeneboronic acid Basic information |
| | 2,6-Bis(trifluoromethyl)benzeneboronic acid Chemical Properties |
| Melting point | 168-171 | | Boiling point | 258.3±50.0 °C(Predicted) | | density | 1.50±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 7.69±0.58(Predicted) | | color | Slightly yellow | | Water Solubility | Insoluble in water. | | InChI | 1S/C8H5BF6O2/c10-7(11,12)4-2-1-3-5(8(13,14)15)6(4)9(16)17/h1-3,16-17H | | InChIKey | WAMPGNNEOZGBHR-UHFFFAOYSA-N | | SMILES | OB(O)c1c(cccc1C(F)(F)F)C(F)(F)F |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-36 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | 2,6-Bis(trifluoromethyl)benzeneboronic acid Usage And Synthesis |
| Uses | 2,6-Bis(trifluoromethyl)benzeneboronic acid is used as pharmaceutical intermediate. |
| | 2,6-Bis(trifluoromethyl)benzeneboronic acid Preparation Products And Raw materials |
|