| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:2-(3-Methyl-3-nitrobutyl)-1,3-dioxolane
CAS:57620-56-1
Purity:97% Package:1G,5G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:2-(3-Methyl-3-nitrobutyl)-1,3-dioxolane
CAS:57620-56-1
Purity:97% Package:5G Remarks:362867-5G
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:2-(3-Methyl-3-nitrobutyl)-1,3-dioxolane
CAS:57620-56-1
|
| Company Name: |
Santa Cruz Biotechnology Inc
|
| Tel: |
021-60936350 |
| Email: |
scbt@scbt.com |
| Products Intro: |
Product Name:2-(3-Methyl-3-nitrobutyl)-1,3-dioxolane
CAS:57620-56-1
|
|
| | 2-(3-METHYL-3-NITROBUTYL)-1,3-DIOXOLANE Basic information |
| | 2-(3-METHYL-3-NITROBUTYL)-1,3-DIOXOLANE Chemical Properties |
| Boiling point | 98-99 °C/1 mmHg (lit.) | | density | 1.13 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.454(lit.) | | Fp | >230 °F | | form | liquid | | InChI | 1S/C8H15NO4/c1-8(2,9(10)11)4-3-7-12-5-6-13-7/h7H,3-6H2,1-2H3 | | InChIKey | ONLCLPRCWSOGPM-UHFFFAOYSA-N | | SMILES | CC(C)(CCC1OCCO1)[N+]([O-])=O |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-(3-METHYL-3-NITROBUTYL)-1,3-DIOXOLANE Usage And Synthesis |
| Uses | 2-(3-Methyl-3-nitrobutyl)-1,3-dioxolane may be used in the preparation of spin trap reagent, dimethyl-Δ′-pyrroline-1-oxide (DMPO). |
| | 2-(3-METHYL-3-NITROBUTYL)-1,3-DIOXOLANE Preparation Products And Raw materials |
|