| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | rac-cis-N-Desmethyl Sertraline Hydrochloride Basic information |
| Product Name: | rac-cis-N-Desmethyl Sertraline Hydrochloride | | Synonyms: | cis- 4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydro-1-naphthalenamine Hydrochloride;Norsertraline hydrochloride solution;Sertraline N-Desmethyl Impurity; cis-(-4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydro-1-naphthalenamine Hydrochloride;rac-Norsertraline Hydrochloride;(+/-)-cis-N-Desmethylsertraline D3 Hydrochloride;Desmethyl Sertraline HydrochlorideQ: What is
Desmethyl Sertraline Hydrochloride Q: What is the CAS Number of
Desmethyl Sertraline Hydrochloride Q: What is the storage condition of
Desmethyl Sertraline Hydrochloride Q: What are the applications of
Desmethyl Sertraline Hydrochloride;Desmethyl Sertraline Hydrochloride | | CAS: | 91797-57-8 | | MF: | C16H16Cl3N | | MW: | 328.66 | | EINECS: | 200-659-6 | | Product Categories: | Drug Analogues;Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals | | Mol File: | 91797-57-8.mol |  |
| | rac-cis-N-Desmethyl Sertraline Hydrochloride Chemical Properties |
| Melting point | 301-303°C | | Fp | 9℃ | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Major Application | clinical testing | | InChI | 1S/C16H15Cl2N.ClH/c17-14-7-5-10(9-15(14)18)11-6-8-16(19)13-4-2-1-3-12(11)13;/h1-5,7,9,11,16H,6,8,19H2;1H/t11-,16-;/m0./s1 | | InChIKey | YKXHIERZIRLOLD-RISSCEEYSA-N | | SMILES | N[C@H]1CC[C@@H](C2=CC(Cl)=C(Cl)C=C2)C3=C1C=CC=C3.[H]Cl | | EPA Substance Registry System | 1-Naphthalenamine, 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-, hydrochloride (1:1), (1R,4R)-rel- (91797-57-8) |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 7-16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | rac-cis-N-Desmethyl Sertraline Hydrochloride Usage And Synthesis |
| Chemical Properties | White Powder | | Uses | A racemate of a metabolite of Sertraline. N-Desmethyl sertraline is significantly less active analogue as compared to the methylated compound, Sertraline |
| | rac-cis-N-Desmethyl Sertraline Hydrochloride Preparation Products And Raw materials |
|