| Company Name: |
Suzhou Meishi Biotechnology Co., Ltd.
|
| Tel: |
1173954148q |
| Email: |
meishipharma@126.com |
| Products Intro: |
Product Name:144665-07-6
CAS:144665-07-6
Purity:99% HPLC Package:1G;5G;10G;100G;1KG;
|
| Company Name: |
TargetMol Chemicals Inc.
|
| Tel: |
15002134094 |
| Email: |
marketing@targetmol.cn |
| Products Intro: |
Product Name:Lubeluzole
CAS:144665-07-6
Package:100mg/RMB 17500;25mg/RMB 10600;50mg/RMB 13800
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Lubeluzole dihydrochloride
CAS:144665-07-6
|
Lubeluzole manufacturers
- Lubeluzole
-
- $2500.00
-
2026-05-11
- CAS:144665-07-6
- Purity:
- Supply Ability: 10g
|
| | Lubeluzole Basic information |
| Product Name: | Lubeluzole | | Synonyms: | (aS)-4-(2-Benzothiazolylmethylamino)-a-[(3,4-difluorophenoxy)methyl]-1-piperidineethanol dihydrochloride;Lubeluzole dihydrochloride;R 87926;1-Piperidineethanol, 4-(2-benzothiazolylmethylamino)-α-[(3,4-difluorophenoxy)methyl]-, (αS)-;Prosynap | | CAS: | 144665-07-6 | | MF: | C22H25F2N3O2S | | MW: | 433.521 | | EINECS: | | | Product Categories: | | | Mol File: | 144665-07-6.mol |  |
| | Lubeluzole Chemical Properties |
| Melting point | 65.8° | | alpha | D20 +4.38° (c = 1 in methanol) | | storage temp. | 2-8°C | | solubility | H2O: soluble2mg/mL, clear (warmed) | | form | powder | | color | white to beige | | Water Solubility | H2O: 2mg/mL, clear (warmed) | | InChI | 1S/C22H25F2N3O2S/c1-26(22-25-20-4-2-3-5-21(20)30-22)15-8-10-27(11-9-15)13-16(28)14-29-17-6-7-18(23)19(24)12-17/h2-7,12,15-16,28H,8-11,13-14H2,1H3/t16-/m0/s1 | | InChIKey | OZFSWVOEXHGDES-INIZCTEOSA-N | | SMILES | Fc1c(ccc(c1)OC[C@@H](O)CN2CCC(CC2)N(C)c3[s]c4c(n3)cccc4)F |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 4 |
| | Lubeluzole Usage And Synthesis |
| Definition | ChEBI: Lubeluzole is a member of benzothiazoles. | | Biological Activity | Lubeluzole is an NMDA antagonist. Lubeluzole blocks glutamate release, as well as sodium and calcium gated ion channels. Lubeluzole displays neuroprotective properties in ischemia models. |
| | Lubeluzole Preparation Products And Raw materials |
|