| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Methyl 2,3,4-triacetate-alpha-D-glucopyranoside Basic information |
| Product Name: | Methyl 2,3,4-triacetate-alpha-D-glucopyranoside | | Synonyms: | [(2R,3R,4S,5R)-3,5-diacetyloxy-2-(hydroxymethyl)-6-methoxy-oxan-4-yl] acetate;methyl 2,3,4-tri-O-acetylglucopyranoside;a-D-Glucopyranoside, methyl, 2,3,4-triacetate;alpha-D-Glucopyranoside, methyl, 2,3,4-triacetate;m-2,3,4-Aaglu;Methyl 2,3,4-tri-o-acetyl-alpha-D-glucopyranoside;Methyl 2,3,4-triacetate-α-D-glucopyranoside;(2R,3R,4S,5R,6S)-2-(Hydroxymethyl)-6-methoxytetrahydro-2H-pyran-3,4,5-triyl triacetate | | CAS: | 7432-72-6 | | MF: | C13H20O9 | | MW: | 320.29 | | EINECS: | | | Product Categories: | Sugars | | Mol File: | 7432-72-6.mol |  |
| | Methyl 2,3,4-triacetate-alpha-D-glucopyranoside Chemical Properties |
| Melting point | 108-113°C | | Boiling point | 389.6±42.0 °C(Predicted) | | density | 1.29±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 14.48±0.10(Predicted) | | form | solid | | Optical Rotation | [α]22/D +148°, c = 1% in DMSO | | InChI | 1S/C13H20O9/c1-6(15)19-10-9(5-14)22-13(18-4)12(21-8(3)17)11(10)20-7(2)16/h9-14H,5H2,1-4H3/t9-,10-,11+,12-,13+/m1/s1 | | InChIKey | OBVFJYUDIWPVKD-LBELIVKGSA-N | | SMILES | OC[C@H]1O[C@H](OC)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Methyl 2,3,4-triacetate-alpha-D-glucopyranoside Usage And Synthesis |
| | Methyl 2,3,4-triacetate-alpha-D-glucopyranoside Preparation Products And Raw materials |
|