| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- Glucose pentaacetate
-
-
2026-09-20
- CAS:604-68-2
- Min. Order: 10g
- Purity: 98.0%
- Supply Ability: 500kg/month
- Glucose pentaacetate
-
- $10.00
-
2025-05-23
- CAS:604-68-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20 ton
|
| | Glucose pentaacetate Basic information |
| Product Name: | Glucose pentaacetate | | Synonyms: | Pentaacetate
Pentaacetyl-alpha-D-glucose;ALPHA-GLUCOSE PENTAACETATE;A-D-GLUCOSE PENTAACETATE;D-A-GLUCOSE PENTAACETATE;1,2,3,4,6-PENTA-O-ACETYL-A-D-GLUCOPYRANOSE;1,2,3,4,6-PENTA-O-ACETYL-A-GLUCOPYRANOSE;1,2,3,4,6-PENTA-O-ACETYL-ALPHA-D-GLUCOPYRANOSE;1,2,3,4,6-PENTA-O-ACETYL-ALPHA-GLUCOPYRANOSE | | CAS: | 604-68-2 | | MF: | C16H22O11 | | MW: | 390.34 | | EINECS: | 210-073-2 | | Product Categories: | chiral;Biochemistry;Glucose;O-Substituted Sugars;Sugars;Dextrins、Sugar & Carbohydrates;Carbohydrates & Derivatives | | Mol File: | 604-68-2.mol |  |
| | Glucose pentaacetate Chemical Properties |
| Melting point | 111-113 °C | | alpha | 97 º (c=1, CHCl3) | | Boiling point | 435.58°C (rough estimate) | | density | 1.3984 (rough estimate) | | vapor pressure | 0-0Pa at 20-50℃ | | FEMA | 2524 | GLUCOSE PENTAACETATE | | refractive index | 105.5 ° (C=1.5, MeOH) | | storage temp. | Sealed in dry,Room Temperature | | solubility | chloroform: 0.1 g/mL, clear, colorless | | form | Powder | | color | White to off-white | | Odor | at 100.00 %. odorless | | Odor Type | odorless | | Optical Rotation | [α]20/D ≥+98°, c = 1 in ethanol | | Water Solubility | < 5 G/L (25 ºC) | | BRN | 98852 | | Cosmetics Ingredients Functions | EMULSION STABILISING | | Cosmetic Ingredient Review (CIR) | Glucose pentaacetate (604-68-2) | | InChI | 1S/C16H22O11/c1-7(17)22-6-12-13(23-8(2)18)14(24-9(3)19)15(25-10(4)20)16(27-12)26-11(5)21/h12-16H,6H2,1-5H3/t12-,13-,14+,15-,16+/m1/s1 | | InChIKey | LPTITAGPBXDDGR-LJIZCISZSA-N | | SMILES | CC(=O)OC[C@H]1O[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O | | LogP | 1.87 at 25℃ and pH5.7 | | CAS DataBase Reference | 604-68-2(CAS DataBase Reference) | | NIST Chemistry Reference | «alpha»-D-Glucopyranose, pentaacetate(604-68-2) | | EPA Substance Registry System | .alpha.-D-Glucopyranose, pentaacetate (604-68-2) |
| | Glucose pentaacetate Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | D-Glucose pentaacetate was reported to stimulate insulin release in rat pancreatic islets. Only α-D-glucose pentaacetate caused an immediate increase in insulin output. The β-anomer of D-glucose pentaacetate first transiently inhibited insulin release, this initial effect being followed by a secondary rise in secretory rate. | | Application | Glucose-penta-acetate is a bitter principle in food products, mainly spice blends, condiments, alcoholic beverages, etc. The concentration is equivalent to about 100 to 1500 ppm in the finished consumer product. | | Purification Methods | Crystallise it from MeOH, EtOH or three recrystallisations from 95% EtOH.
[Wolfrom & Thompson Methods in Carbohydrate Chemistry II 212 1963, Academic Press, Beilstein 17/7 V
318.] |
| | Glucose pentaacetate Preparation Products And Raw materials |
|