|
|
| Product Name: | Bis(vinylsulfonyl)propanol | | Synonyms: | BIS(VINYLSULFONYLMETHYL)CARBINOL;BI(VINYLSULFONE)PROPYL ALCOHOL;1,3-BIS(VINYLSULFONYL)-2-PROPANOL;1,3-Bis(vinylsulfonyl)-2-hydroxypropane;1,3-Divinylsulfonyl-2-hydroxypropane;Bis(vinylsulfonyl)propanol;Bis (vinyl sulfone) propanol;1,3-Bis(vinylsulfonyl)propan-2-ol | | CAS: | 67006-32-0 | | MF: | C7H12O5S2 | | MW: | 240.3 | | EINECS: | | | Product Categories: | | | Mol File: | 67006-32-0.mol |  |
| | Bis(vinylsulfonyl)propanol Chemical Properties |
| Melting point | 96°C | | Boiling point | 554.7±45.0 °C(Predicted) | | density | 1.379 | | form | powder to crystal | | pka | 12+-.0.20(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C7H12O5S2/c1-3-13(9,10)5-7(8)6-14(11,12)4-2/h3-4,7-8H,1-2,5-6H2 | | InChIKey | SOBDFTUDYRPGJY-UHFFFAOYSA-N | | SMILES | C(S(C=C)(=O)=O)C(O)CS(C=C)(=O)=O | | CAS DataBase Reference | 67006-32-0(CAS DataBase Reference) |
| | Bis(vinylsulfonyl)propanol Usage And Synthesis |
| Physical Form | White to Yellow Solid | | Uses | Bis(vinylsulfonyl)propanol is a useful research chemical. |
| | Bis(vinylsulfonyl)propanol Preparation Products And Raw materials |
|