corannulene manufacturers
- Corannulene
-
- $2.00 / 100kg
-
2025-08-08
- CAS:5821-51-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | corannulene Basic information |
| Product Name: | corannulene | | Synonyms: | corannulene;1,10:6,7-Diethenofluoranthene;Dibenzo[ghi,mno]fluoranthene;Coarannulen;Corannulene > | | CAS: | 5821-51-2 | | MF: | C20H10 | | MW: | 250.29 | | EINECS: | | | Product Categories: | | | Mol File: | 5821-51-2.mol |  |
| | corannulene Chemical Properties |
| Melting point | 269°C(lit.) | | Boiling point | 438.0±12.0 °C(Predicted) | | density | 1.467±0.06 g/cm3(Predicted) | | form | powder to crystal | | color | White to Yellow to Green | | InChI | InChI=1S/C20H10/c1-2-12-5-6-14-9-10-15-8-7-13-4-3-11(1)16-17(12)19(14)20(15)18(13)16/h1-10H | | InChIKey | VXRUJZQPKRBJKH-UHFFFAOYSA-N | | SMILES | C12C=CC3=C4C1=C1C5=C4C(=CC=C5C=CC1=CC=2)C=C3 |
| | corannulene Usage And Synthesis |
| Uses | The corannulene group is used in host-guest chemistry with interactions based on pi stacking, notably with fullerenes (the buckycatcher) but also with nitrobenzene. |
| | corannulene Preparation Products And Raw materials |
| Raw materials | Dibenzo[ghi,mno]fluoranthene, 1,2,5,6-tetrabromo--->Fluoranthene, 1,6,7,10-tetrakis(bromomethyl)--->1,1'-(7,10-Fluoranthenediyl)bis-ethanone-->7,10-Fluoranthenedicarboxylic acid, 7,10-dimethyl ester-->Fluoranthene, 1,6,7,10-tetrakis(dibromomethyl)--->4H-Cyclopenta[def]phenanthrene-3-carboxylic acid, 4-bromo-, methyl ester-->Fluoranthene, 7,10-bis(2,2-dibromoethenyl)- | | Preparation Products | Pyrene |
|