| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | maesopsin Basic information |
| Product Name: | maesopsin | | Synonyms: | maesopsin;2,4,6-Trihydroxy-2-(4-hydroxybenzyl)benzofuran-3(2H)-one;2,4,6-Trihydroxy-2-[(4-hydroxyphenyl)methyl]benzofuran-3(2H)-one;Mesopsin;3(2H)-Benzofuranone, 2,4,6-trihydroxy-2-[(4-hydroxyphenyl)methyl]-, (2R)-;Maesopsin >=90% (LC/MS-ELSD) | | CAS: | 5989-16-2 | | MF: | C15H12O6 | | MW: | 288.25 | | EINECS: | | | Product Categories: | | | Mol File: | 5989-16-2.mol |  |
| | maesopsin Chemical Properties |
| Melting point | 218-220 °C | | Boiling point | 620.0±55.0 °C(Predicted) | | density | 1.646±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 7.29±0.40(Predicted) | | form | Solid | | color | White to off-white | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C15H12O6/c16-9-3-1-8(2-4-9)7-15(20)14(19)13-11(18)5-10(17)6-12(13)21-15/h1-6,16-18,20H,7H2 | | InChIKey | LOFYFDPXORJJEE-UHFFFAOYSA-N | | SMILES | Oc1ccc(CC2(O)Oc3cc(O)cc(O)c3C2=O)cc1 |
| Hazard Codes | N | | Risk Statements | 50 | | Safety Statements | 61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 |
| | maesopsin Usage And Synthesis |
| Uses | Maesopsin is a compound isolated from the roots of Rheum emodi and has been shown to display significant antioxidant activity in a DPPH assay. | | Definition | ChEBI: Maesopsin is a member of aurones. |
| | maesopsin Preparation Products And Raw materials |
|