| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:2,4,6-Trichloro CAS:352439-08-8 Package:10Mg,1Mg
|
|
| | 2,4,6-TRICHLOROANISOLE-D5 Basic information |
| Product Name: | 2,4,6-TRICHLOROANISOLE-D5 | | Synonyms: | 2,4,6-TRICHLOROANISOLE-D5;2,4,6-TRICHLOROANISOLE, [METHYL-D3];2,4,6-Trichloro;2,4,6-Trichloroanisole-d5;Wine Standard;1,3,5-trichloro-2,4-dideuterio-6-(trideuteriomethoxy)benzene;2,4,6-TRICHLOROANISOLE (D5, 98%);2,4,6-Trichloroanisole-d? | | CAS: | 352439-08-8 | | MF: | C7Cl3D5O | | MW: | 216.5 | | EINECS: | | | Product Categories: | Aromatics;Isotope Labelled Compounds;DeuteriumAnalytical Standards;Labeled Standards;NeatsAlphabetic;TP - TZ;Type of Labeling;Alphabetical Listings;Stable Isotopes | | Mol File: | 352439-08-8.mol |  |
| | 2,4,6-TRICHLOROANISOLE-D5 Chemical Properties |
| Melting point | 60-62 °C(lit.) | | Boiling point | 132 °C/28 mmHg(lit.) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Very Slightly) | | form | Solid | | color | White to off-white | | Major Application | agriculture cleaning products cosmetics environmental flavors and fragrances food and beverages personal care | | InChI | 1S/C7H5Cl3O/c1-11-7-5(9)2-4(8)3-6(7)10/h2-3H,1H3/i1D3,2D,3D | | InChIKey | WCVOGSZTONGSQY-RHIBPKLGSA-N | | SMILES | [2H]c1c(Cl)c([2H])c(Cl)c(OC([2H])([2H])[2H])c1Cl |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 Eye Irrit. 2 |
| | 2,4,6-TRICHLOROANISOLE-D5 Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | This product may be used as an analytical standard. | | Uses | Labelled 2,4,6-Trichloro |
| | 2,4,6-TRICHLOROANISOLE-D5 Preparation Products And Raw materials |
|