| Company Name: |
Grader reagent |
| Tel: |
18221735425 |
| Email: |
sales@xinpingchem.com |
4-(2-Aminoethyl)amino-7-chloroquinoline manufacturers
|
| | 4-(2-Aminoethyl)amino-7-chloroquinoline Basic information |
| Product Name: | 4-(2-Aminoethyl)amino-7-chloroquinoline | | Synonyms: | N-(2-aminoethyl)-7-chloroquinolin-4-amine;1,2-EthanediaMine,N1-(7-chloro-4-quinolinyl)-;N1-(7-Chloro-quinolin-4-yl)-ethane-1,2-diaMine;N'-(7-CHLOROQUINOLIN-4-YL)ETHANE-1,2-DIAMINE;N-(7-chloro-4-quinolyl)ethane-1,2-diamine;N1-7-hloro--uinolinyl)1,-thanediamine;2-aminoethyl-(7-chloro-4-quinolyl)amine;N1-(7-Chloro-4-quinolinyl)-1,2-ethanediamine | | CAS: | 5407-57-8 | | MF: | C11H12ClN3 | | MW: | 221.69 | | EINECS: | | | Product Categories: | | | Mol File: | 5407-57-8.mol |  |
| | 4-(2-Aminoethyl)amino-7-chloroquinoline Chemical Properties |
| Melting point | 137-139 °C | | Boiling point | 415.0±40.0 °C(Predicted) | | density | 1.316±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | form | Solid | | pka | 9.11±0.10(Predicted) | | color | White to off-white | | InChI | InChI=1S/C11H12ClN3/c12-8-1-2-9-10(15-6-4-13)3-5-14-11(9)7-8/h1-3,5,7H,4,6,13H2,(H,14,15) | | InChIKey | XBDASFGJHWAFFE-UHFFFAOYSA-N | | SMILES | C(NC1C2C(N=CC=1)=CC(Cl)=CC=2)CN |
| | 4-(2-Aminoethyl)amino-7-chloroquinoline Usage And Synthesis |
| Uses | Antimalarial agent 39 (compound 1) is an intermediate in the synthesis of antimalarial agents[1]. | | References | [1] Kondaparla S, Agarwal P, Srivastava K, Puri SK, Katti SB. Design, synthesis and in vitro antiplasmodial activity of some bisquinolines against chloroquine-resistant strain. Chem Biol Drug Des. 2017 Jun;89(6):901-906. DOI:10.1111/cbdd.12914 |
| | 4-(2-Aminoethyl)amino-7-chloroquinoline Preparation Products And Raw materials |
|