|
|
| | 2-(4-Methoxy-phenyl)-thiazole-4-carboxylic acid ethyl ester Basic information |
| Product Name: | 2-(4-Methoxy-phenyl)-thiazole-4-carboxylic acid ethyl ester | | Synonyms: | ETHYL 2-(4-METHOXYPHENYL)-1,3-THIAZOLE-4-CARBOXYLATE;Ethyl 2-(4-methoxyphenyl)thiazole-4-carboxylate;4-Thiazolecarboxylic acid, 2-(4-methoxyphenyl)-, ethyl ester;2-(4-methoxyphenyl)-4-thiazolecarboxylic acid ethyl ester;JR-13449, Ethyl 2-(4-methoxyphenyl)thiazole-4-carboxylate, 96%;2-(4-Methoxy-phenyl)-thiazole-4-carboxylic acid ethyl ester | | CAS: | 57677-79-9 | | MF: | C13H13NO3S | | MW: | 263.31 | | EINECS: | 604-604-1 | | Product Categories: | | | Mol File: | 57677-79-9.mol |  |
| | 2-(4-Methoxy-phenyl)-thiazole-4-carboxylic acid ethyl ester Chemical Properties |
| Melting point | 94-96°C | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | InChI | 1S/C13H13NO3S/c1-3-17-13(15)11-8-18-12(14-11)9-4-6-10(16-2)7-5-9/h4-8H,3H2,1-2H3 | | InChIKey | IZEUWGPRBNUAFE-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1csc(n1)-c2ccc(OC)cc2 |
| Hazard Codes | Xi | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2934100090 | | Storage Class | 11 - Combustible Solids |
| | 2-(4-Methoxy-phenyl)-thiazole-4-carboxylic acid ethyl ester Usage And Synthesis |
| | 2-(4-Methoxy-phenyl)-thiazole-4-carboxylic acid ethyl ester Preparation Products And Raw materials |
|