| Company Name: |
parabiochem |
| Tel: |
025-83453382-8005 |
| Email: |
sale@parabiochem.com |
|
| | dibenzothiophene-4-carboxylic acid Basic information |
| Product Name: | dibenzothiophene-4-carboxylic acid | | Synonyms: | dibenzothiophene-4-carboxylic acid;4-DIBENZOTHIOPHENECARBOXYLIC ACID;8-thiatricyclo[7.4.0.0^{2,7}]trideca-1(9),2,4,6,10,12-hexaene-6-carboxylic acid | | CAS: | 2786-08-5 | | MF: | C13H8O2S | | MW: | 228.27 | | EINECS: | | | Product Categories: | | | Mol File: | 2786-08-5.mol |  |
| | dibenzothiophene-4-carboxylic acid Chemical Properties |
| storage temp. | Store at room temperature | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C13H8O2S/c14-13(15)10-6-3-5-9-8-4-1-2-7-11(8)16-12(9)10/h1-7H,(H,14,15) | | InChIKey | WHDBZUDFOQNASQ-UHFFFAOYSA-N | | SMILES | C12=C(C(O)=O)C=CC=C1C1=CC=CC=C1S2 |
| | dibenzothiophene-4-carboxylic acid Usage And Synthesis |
| | dibenzothiophene-4-carboxylic acid Preparation Products And Raw materials |
|