| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | dibenzo[b,d]thiophene-4-carbaldehyde Basic information |
| Product Name: | dibenzo[b,d]thiophene-4-carbaldehyde | | Synonyms: | dibenzo[b,d]thiophene-4-carbaldehyde;dibenzo[b,d]thiophene-4-carbaldehyde(SALTDATA: FREE);4-Dibenzothiophenecarboxaldehyde;Dibenzo[b,d]thiophene-4-carboxaldehyde, 98%;Dibenzothiophene-4-carboxaldehyde;Dibenzo[b,d]thiophene-4-carbaldehyde AldrichCPR;Dibenzothiophene-4-carboxaldehyde >dibenzo[b,d]thiophene-4-carbaldehyde ISO 9001:2015 REACH | | CAS: | 23985-81-1 | | MF: | C13H8OS | | MW: | 212.27 | | EINECS: | | | Product Categories: | | | Mol File: | 23985-81-1.mol | ![dibenzo[b,d]thiophene-4-carbaldehyde Structure](CAS/GIF/23985-81-1.gif) |
| | dibenzo[b,d]thiophene-4-carbaldehyde Chemical Properties |
| Melting point | 125.0 to 129.0 °C | | Boiling point | 403.6±18.0 °C(Predicted) | | density | 1.336±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Powder | | color | Pale yellow | | InChI | InChI=1S/C13H8OS/c14-8-9-4-3-6-11-10-5-1-2-7-12(10)15-13(9)11/h1-8H | | InChIKey | XESZAOMRYLSHOM-UHFFFAOYSA-N | | SMILES | C12=C(C=O)C=CC=C1C1=CC=CC=C1S2 |
| Risk Statements | 22-36/37/38 | | Safety Statements | 26-36/37-60 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | dibenzo[b,d]thiophene-4-carbaldehyde Usage And Synthesis |
| Uses | dibenzo[b,d]thiophene-4-carbaldehyde is used as a research compound for organic synthesis, etc. |
| | dibenzo[b,d]thiophene-4-carbaldehyde Preparation Products And Raw materials |
|