| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
1,4-Diacetoxybutane manufacturers
- 1,4-DIACETOXYBUTANE
-
- $1.00
-
2020-02-17
- CAS:628-67-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kgs
|
| | 1,4-Diacetoxybutane Basic information |
| Product Name: | 1,4-Diacetoxybutane | | Synonyms: | 4-(Acetyloxy)butyl acetate;butane-1,4-diol diacetate;Butylene glycol diacetate;Tetramethylene acetate;TETRAMETHYLENE DIACETATE;TIMTEC-BB SBB008237;1,4-BUTYLENE DIACETATE;1,4-BUTYLENE GLYCOL DIACETATE | | CAS: | 628-67-1 | | MF: | C8H14O4 | | MW: | 174.19 | | EINECS: | | | Product Categories: | | | Mol File: | 628-67-1.mol |  |
| | 1,4-Diacetoxybutane Chemical Properties |
| Melting point | 12-15°C | | Boiling point | 130-131°C 20mm | | density | 1,048 g/cm3 | | refractive index | 1.4240 | | Fp | 230°C | | storage temp. | Store at room temperature | | form | clear liquid | | color | Colorless to Almost colorless | | Water Solubility | 34.94g/L(26 ºC) | | BRN | 1768757 | | InChI | InChI=1S/C8H14O4/c1-7(9)11-5-3-4-6-12-8(2)10/h3-6H2,1-2H3 | | InChIKey | XUKSWKGOQKREON-UHFFFAOYSA-N | | SMILES | C(OC(=O)C)CCCOC(=O)C | | LogP | 0.960 (est) | | CAS DataBase Reference | 628-67-1(CAS DataBase Reference) | | EPA Substance Registry System | 1,4-Butanediol, diacetate (628-67-1) |
| Safety Statements | 24/25 | | TSCA | TSCA listed | | HS Code | 2917.19.7050 |
| Provider | Language |
|
ALFA
| English |
| | 1,4-Diacetoxybutane Usage And Synthesis |
| Definition | ChEBI: An acetate ester obtained by the formal condensation of the two hydroxy groups of butane-1,4-diol with two molecules of acetic acid |
| | 1,4-Diacetoxybutane Preparation Products And Raw materials |
|